The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(3-bromo-4-hydroxybenzylidene)-4-(3,5-dibromo-4-methoxyphenyl)-3-(furan-2-carbonyl)furan-2(5H)-one ID: ALA3585733
PubChem CID: 122179830
Max Phase: Preclinical
Molecular Formula: C23H13Br3O6
Molecular Weight: 625.06
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(Br)cc(C2=C(C(=O)c3ccco3)C(=O)O/C2=C\c2ccc(O)c(Br)c2)cc1Br
Standard InChI: InChI=1S/C23H13Br3O6/c1-30-22-14(25)9-12(10-15(22)26)19-18(8-11-4-5-16(27)13(24)7-11)32-23(29)20(19)21(28)17-3-2-6-31-17/h2-10,27H,1H3/b18-8-
Standard InChI Key: ZQTCTPAAEFHHAE-LSCVHKIXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2506 0.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6137 -3.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1277 1.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0972 -7.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1467 -1.8743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2866 3.0610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9143 -5.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3890 0.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5211 -8.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7938 -6.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6799 1.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9105 3.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9175 2.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6416 -7.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2008 -8.7105 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.3382 -5.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7638 -9.5596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5956 2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 3 1 0
5 2 1 0
6 1 1 0
7 3 1 0
8 12 1 0
9 4 2 0
10 6 1 0
11 13 1 0
12 14 2 0
13 7 2 0
14 7 1 0
15 21 1 0
16 2 2 0
17 10 1 0
18 9 1 0
19 6 2 0
20 25 1 0
21 18 2 0
22 10 2 0
23 17 1 0
24 22 1 0
25 30 2 0
26 12 1 0
27 11 1 0
28 8 1 0
29 15 1 0
30 18 1 0
31 20 1 0
5 4 1 0
23 24 2 0
8 11 2 0
15 20 2 0
28 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 625.06Molecular Weight (Monoisotopic): 621.8262AlogP: 6.52#Rotatable Bonds: 5Polar Surface Area: 85.97Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.51CX Basic pKa: ┄CX LogP: 6.12CX LogD: 5.88Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.20Np Likeness Score: 0.51
References 1. Boulangé A, Parraga J, Galán A, Cabedo N, Leleu S, Sanz MJ, Cortes D, Franck X.. (2015) Synthesis and antibacterial activities of cadiolides A, B and C and analogues., 23 (13): [PMID:25913865 ] [10.1016/j.bmc.2015.04.010 ]