The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
esculentin A ID: ALA3586098
PubChem CID: 122180083
Max Phase: Preclinical
Molecular Formula: C24H32O6
Molecular Weight: 416.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C/C(C)=C/C[C@]1(C)[C@H](C)CC[C@@]23C(=CC(=O)C[C@@H]12)[C@@H](OC(C)=O)O[C@H]3OC(C)=O
Standard InChI: InChI=1S/C24H32O6/c1-7-14(2)8-10-23(6)15(3)9-11-24-19(12-18(27)13-20(23)24)21(28-16(4)25)30-22(24)29-17(5)26/h7-8,12,15,20-22H,1,9-11,13H2,2-6H3/b14-8+/t15-,20+,21+,22-,23-,24-/m1/s1
Standard InChI Key: RSQJWXPIJIXDDX-VAPGVGGTSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
2.9679 -1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1976 -2.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2622 -3.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3161 -3.2695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6885 1.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6885 0.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4573 2.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7739 1.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9699 -0.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2891 0.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2891 1.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9699 2.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7739 0.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4573 -0.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6508 -2.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3016 -2.4624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5654 -0.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4302 2.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9899 4.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4756 4.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0354 5.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2164 3.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2233 5.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3244 2.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8646 -2.9937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2300 -2.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3439 -1.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2078 -3.0661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7328 2.2798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7728 2.6885 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0183 1.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
5 6 1 0
5 7 1 0
6 14 2 0
8 7 1 0
8 13 1 0
8 12 1 0
13 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 14 1 1
14 15 1 0
15 16 1 0
13 17 1 0
12 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
21 23 2 0
11 24 1 6
15 25 1 6
25 26 1 0
26 27 1 0
26 28 2 0
5 29 2 0
8 30 1 6
12 31 1 1
17 16 1 0
17 1 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.51Molecular Weight (Monoisotopic): 416.2199AlogP: 4.26#Rotatable Bonds: 5Polar Surface Area: 78.90Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.01CX LogD: 4.01Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: 3.36
References 1. De Ford C, Calderón C, Sehgal P, Fedosova NU, Murillo R, Olesen C, Nissen P, Møller JV, Merfort I.. (2015) Discovery of Tricyclic Clerodane Diterpenes as Sarco/Endoplasmic Reticulum Ca(2+)-ATPase Inhibitors and Structure-Activity Relationships., 78 (6): [PMID:25993619 ] [10.1021/acs.jnatprod.5b00062 ]