The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl trans-5-(5-acetamido-1,3-dioxo-2,3-dihydro-1Hbenzo[de]izochinolin-2-ylmethyl)-2-methylisoxazolidin-3-yl-3-phosphonate ID: ALA3586169
PubChem CID: 122180148
Max Phase: Preclinical
Molecular Formula: C23H28N3O7P
Molecular Weight: 489.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)[C@@H]1C[C@@H](CN2C(=O)c3cccc4cc(NC(C)=O)cc(c34)C2=O)ON1C
Standard InChI: InChI=1S/C23H28N3O7P/c1-5-31-34(30,32-6-2)20-12-17(33-25(20)4)13-26-22(28)18-9-7-8-15-10-16(24-14(3)27)11-19(21(15)18)23(26)29/h7-11,17,20H,5-6,12-13H2,1-4H3,(H,24,27)/t17-,20+/m0/s1
Standard InChI Key: VLZXYAAFBWJFCV-FXAWDEMLSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-5.3699 -6.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7915 -7.0948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5914 -1.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5832 -8.2191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9033 -3.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1612 -6.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6927 -4.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9003 -8.6142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2804 -8.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5158 -10.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0236 -9.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6612 -6.0252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0864 -8.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1197 -4.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8950 -2.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2847 -7.2455 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6307 0.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 -3.4629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 -1.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 4.5117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 5.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 4.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3064 6.4602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 15 1 0
14 12 1 0
11 10 1 0
7 5 1 0
6 16 1 1
16 2 1 0
5 15 1 6
16 8 1 0
8 11 1 0
6 7 1 0
2 13 1 0
12 6 1 0
12 1 1 0
16 4 2 0
5 14 1 0
13 9 1 0
30 17 1 0
21 24 1 0
25 22 2 0
20 19 1 0
3 25 1 0
25 18 1 0
24 28 2 0
17 3 1 0
27 18 2 0
23 20 2 0
18 23 1 0
19 21 2 0
28 29 1 0
29 30 2 0
27 21 1 0
17 26 2 0
27 30 1 0
20 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.47Molecular Weight (Monoisotopic): 489.1665AlogP: 3.62#Rotatable Bonds: 8Polar Surface Area: 114.48Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.85CX Basic pKa: ┄CX LogP: 1.60CX LogD: 1.60Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.52
References 1. Kokosza K, Andrei G, Schols D, Snoeck R, Piotrowska DG.. (2015) Design, antiviral and cytostatic properties of isoxazolidine-containing amonafide analogues., 23 (13): [PMID:26001344 ] [10.1016/j.bmc.2015.04.079 ]