2-(6-(4-(3-methyl-2-(5-(pyridin-2-ylmethoxy)pyridin-2-yl)butan-2-yl)phenyl)pyridazin-3-yl)propan-2-ol

ID: ALA3586208

Cas Number: 954104-50-8

PubChem CID: 24758849

Max Phase: Preclinical

Molecular Formula: C29H32N4O2

Molecular Weight: 468.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C(C)(c1ccc(-c2ccc(C(C)(C)O)nn2)cc1)c1ccc(OCc2ccccn2)cn1

Standard InChI:  InChI=1S/C29H32N4O2/c1-20(2)29(5,27-15-13-24(18-31-27)35-19-23-8-6-7-17-30-23)22-11-9-21(10-12-22)25-14-16-26(33-32-25)28(3,4)34/h6-18,20,34H,19H2,1-5H3

Standard InChI Key:  CXGCXASRQWJMND-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    3.1475    7.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9206    6.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3287    7.7812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3258   -1.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8388   -0.1385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8747    1.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3975    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1156   -0.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8486   -1.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3879    2.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8648    2.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3756    4.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4096    5.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9328    4.9788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4220    3.5684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8486   -3.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4507   -4.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0633   -5.4698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9002   -6.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3776   -6.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8915   -4.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9280   -3.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8880   -3.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4780   -2.5473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5163   -3.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3439   -7.5083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8217   -7.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7881   -8.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2655   -8.1354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2290   -9.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7151  -10.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2377  -10.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2742   -9.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1019    6.8637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4803   -1.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  6 10  1  0
  9 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 23  1  0
 16 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 13  2  1  0
  2 34  1  0
 24 35  1  0
M  END

Associated Targets(Human)

Whole blood (398 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.60Molecular Weight (Monoisotopic): 468.2525AlogP: 5.70#Rotatable Bonds: 8
Polar Surface Area: 81.02Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.78CX Basic pKa: 4.21CX LogP: 5.13CX LogD: 5.13
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.04

References

1. Pettersen D, Davidsson Ö, Whatling C..  (2015)  Recent advances for FLAP inhibitors.,  25  (13): [PMID:26004579] [10.1016/j.bmcl.2015.04.090]

Source