cortexolone-17alpha,21-dipropionate

ID: ALA3588894

PubChem CID: 67088388

Max Phase: Preclinical

Molecular Formula: C27H38O6

Molecular Weight: 458.60

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCC(=O)OCC(=O)[C@@]1(OC(=O)CC)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C

Standard InChI:  InChI=1S/C27H38O6/c1-5-23(30)32-16-22(29)27(33-24(31)6-2)14-11-21-19-8-7-17-15-18(28)9-12-25(17,3)20(19)10-13-26(21,27)4/h15,19-21H,5-14,16H2,1-4H3/t19-,20+,21+,25+,26+,27+/m1/s1

Standard InChI Key:  FAZSVJOMLJRPMK-XYZFIOBHSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -4.1792   -0.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1792   -1.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9382   -2.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9565    0.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6790   -0.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6790   -1.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4197   -2.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8212   -1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4380    0.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030   -0.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030    2.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4562    1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0440    1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0440    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625    0.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625    1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3032    2.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2209   -2.4390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6930    0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413    2.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5993    3.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5927    4.4532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9034    2.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1993    3.2675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3183    3.6431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8229    5.0565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8519    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0034    5.2718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2554    7.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6715   -0.8608    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4332   -0.6715    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2979   -0.6205    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5033    2.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7992    3.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5099    1.3246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8419    2.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  2  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  2 18  2  0
  5 19  1  1
 13 20  1  1
 17 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 17 25  1  6
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 10 30  1  1
  9 31  1  6
 14 32  1  6
 24 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3588894

   [2-[(8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-17-propanoyloxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 458.60

Molecular Weight (Monoisotopic): 458.2668

AlogP: 4.73

#Rotatable Bonds: 6

Polar Surface Area: 86.74

Molecular Species: NEUTRAL

HBA: 6

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 6

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.87

CX LogD: 4.87

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.53

Np Likeness Score: 1.44

References

1. Ferraboschi P, Legnani L, Celasco G, Moro L, Ragonesi L, Colombo D.  (2014)  A full conformational characterization of antiandrogen cortexolone-17-propionate and related compounds through theoretical calculations and nuclear magnetic resonance spectroscopy,  5  (7): [10.1039/C4MD00049H]

Source

Source(1):

• Scientific Literature