1-(4-(4-(4-(((2-aminoethyl)(methyl)amino)methyl)-1H-pyrazol-3-yl)phenyl)piperazin-1-yl)-2-phenylethanone

ID: ALA3589041

Max Phase: Preclinical

Molecular Formula: C25H32N6O

Molecular Weight: 432.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(CCN)Cc1c[nH]nc1-c1ccc(N2CCN(C(=O)Cc3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C25H32N6O/c1-29(12-11-26)19-22-18-27-28-25(22)21-7-9-23(10-8-21)30-13-15-31(16-14-30)24(32)17-20-5-3-2-4-6-20/h2-10,18H,11-17,19,26H2,1H3,(H,27,28)

Standard InChI Key:  ORUDTJGTLCZELU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2568    0.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6819    1.0556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5772    0.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9880    2.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4132    2.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6580    4.1702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9015    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5018    3.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5058    4.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7993    2.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1017    3.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3996    2.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6999    3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7023    5.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4045    5.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1042    5.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  1  6  1  0
  6  7  1  0
  2  8  1  0
  7  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  8  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 15 18  1  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3589041

    ---

Associated Targets(Human)

PRMT8 Tchem Protein arginine N-methyltransferase 8 (122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRMT6 Tchem Protein arginine N-methyltransferase 6 (321 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRMT1 Tchem Protein-arginine N-methyltransferase 1 (867 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.57Molecular Weight (Monoisotopic): 432.2638AlogP: 2.36#Rotatable Bonds: 8
Polar Surface Area: 81.49Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.39CX LogP: 2.47CX LogD: 0.50
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -1.62

References

1. Mitchell LH, Drew AE, Ribich SA, Rioux N, Swinger KK, Jacques SL, Lingaraj T, Boriack-Sjodin PA, Waters NJ, Wigle TJ, Moradei O, Jin L, Riera T, Porter-Scott M, Moyer MP, Smith JJ, Chesworth R, Copeland RA..  (2015)  Aryl Pyrazoles as Potent Inhibitors of Arginine Methyltransferases: Identification of the First PRMT6 Tool Compound.,  (6): [PMID:26101569] [10.1021/acsmedchemlett.5b00071]

Source