The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(6-bromobenzo[d][1,3]dioxol-5-yl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl)-4-(4-nitrophenyl)thiazole ID: ALA3589312
PubChem CID: 122180785
Max Phase: Preclinical
Molecular Formula: C23H15BrN4O4S2
Molecular Weight: 555.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1ccc(-c2csc(N3N=C(c4cccs4)CC3c3cc4c(cc3Br)OCO4)n2)cc1
Standard InChI: InChI=1S/C23H15BrN4O4S2/c24-16-9-21-20(31-12-32-21)8-15(16)19-10-17(22-2-1-7-33-22)26-27(19)23-25-18(11-34-23)13-3-5-14(6-4-13)28(29)30/h1-9,11,19H,10,12H2
Standard InChI Key: LVSOEFZXQRFMPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
-5.2259 3.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4652 1.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2867 0.5895 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-9.7260 1.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.7689 2.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3562 3.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6389 3.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1718 3.7645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5265 5.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6150 6.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9329 5.4346 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9490 5.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0025 4.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4525 4.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8448 6.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7872 7.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3372 6.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.2948 6.5510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6071 7.7096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1424 5.7015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 2 0
5 6 1 0
11 12 2 0
12 13 1 0
13 16 2 0
15 14 2 0
14 11 1 0
3 11 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
2 20 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
12 31 1 0
32 33 2 0
32 34 1 0
28 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.44Molecular Weight (Monoisotopic): 553.9718AlogP: 6.63#Rotatable Bonds: 5Polar Surface Area: 90.09Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.82CX LogP: 7.04CX LogD: 7.04Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.20Np Likeness Score: -1.61
References 1. Shahavar Sulthana S, Arul Antony S, Balachandran C, Syed Shafi S.. (2015) Thiophene and benzodioxole appended thiazolyl-pyrazoline compounds: Microwave assisted synthesis, antimicrobial and molecular docking studies., 25 (14): [PMID:26028159 ] [10.1016/j.bmcl.2015.05.033 ]