The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(6-bromobenzo[d][1,3]dioxol-5-yl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl)-4-(4-chloro-2-fluorophenyl)thiazole ID: ALA3589319
PubChem CID: 122180792
Max Phase: Preclinical
Molecular Formula: C23H14BrClFN3O2S2
Molecular Weight: 562.87
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Fc1cc(Cl)ccc1-c1csc(N2N=C(c3cccs3)CC2c2cc3c(cc2Br)OCO3)n1
Standard InChI: InChI=1S/C23H14BrClFN3O2S2/c24-15-8-21-20(30-11-31-21)7-14(15)19-9-17(22-2-1-5-32-22)28-29(19)23-27-18(10-33-23)13-4-3-12(25)6-16(13)26/h1-8,10,19H,9,11H2
Standard InChI Key: WBZZKZHYDWWFOK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-5.2259 3.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4652 1.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2867 0.5895 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-9.7260 1.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.7689 2.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3562 3.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6389 3.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1718 3.7645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5265 5.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6150 6.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9329 5.4346 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9490 5.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3372 6.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7872 7.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8448 6.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4525 4.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0025 4.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.0048 6.4710 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.6882 3.1737 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 2 0
5 6 1 0
11 12 2 0
12 13 1 0
13 16 2 0
15 14 2 0
14 11 1 0
3 11 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
2 20 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
12 31 1 0
28 32 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.87Molecular Weight (Monoisotopic): 560.9383AlogP: 7.51#Rotatable Bonds: 4Polar Surface Area: 46.95Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.60CX LogP: 7.84CX LogD: 7.84Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -1.72
References 1. Shahavar Sulthana S, Arul Antony S, Balachandran C, Syed Shafi S.. (2015) Thiophene and benzodioxole appended thiazolyl-pyrazoline compounds: Microwave assisted synthesis, antimicrobial and molecular docking studies., 25 (14): [PMID:26028159 ] [10.1016/j.bmcl.2015.05.033 ]