The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy)butanoic acid ID: ALA3590141
PubChem CID: 122181380
Max Phase: Preclinical
Molecular Formula: C19H24F6O4
Molecular Weight: 430.39
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCC(=O)O
Standard InChI: InChI=1S/C19H24F6O4/c1-3-6-12-10-14(17(28,18(20,21)22)19(23,24)25)11-13(7-4-2)16(12)29-9-5-8-15(26)27/h10-11,28H,3-9H2,1-2H3,(H,26,27)
Standard InChI Key: JOLUEAVJLHHISJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5983 -3.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5992 -0.3004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9383 -1.3508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8994 0.4492 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9383 -0.1510 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6370 -3.6021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5587 -3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5974 -4.2012 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6331 -3.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3063 4.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8024 2.6887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.8387 0.8872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
7 9 1 0
7 10 1 0
8 11 1 0
8 12 1 0
8 13 1 0
9 14 1 0
9 15 1 0
9 16 1 0
5 17 1 0
17 18 1 0
18 19 1 0
3 20 1 0
20 21 1 0
21 22 1 0
4 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.39Molecular Weight (Monoisotopic): 430.1579AlogP: 5.15#Rotatable Bonds: 10Polar Surface Area: 66.76Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.22CX Basic pKa: ┄CX LogP: 5.75CX LogD: 2.46Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -0.02
References 1. Koura M, Matsuda T, Okuda A, Watanabe Y, Yamaguchi Y, Kurobuchi S, Matsumoto Y, Shibuya K.. (2015) Design, synthesis and pharmacology of 1,1-bistrifluoromethylcarbinol derivatives as liver X receptor β-selective agonists., 25 (13): [PMID:25998501 ] [10.1016/j.bmcl.2015.04.080 ]