1-{2-[3-(Benzhydryl-amino)-2-hydroxy-propoxy]-phenyl}-3-phenyl-propan-1-one

ID: ALA359190

PubChem CID: 44364346

Max Phase: Preclinical

Molecular Formula: C31H31NO3

Molecular Weight: 465.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccccc1)c1ccccc1OCC(O)CNC(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C31H31NO3/c33-27(22-32-31(25-14-6-2-7-15-25)26-16-8-3-9-17-26)23-35-30-19-11-10-18-28(30)29(34)21-20-24-12-4-1-5-13-24/h1-19,27,31-33H,20-23H2

Standard InChI Key:  KYWRASYTPSAUIR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    3.9750   -1.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5417    0.0458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -1.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875    0.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -1.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750    0.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167    0.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -0.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -2.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -3.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1125    0.8583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -1.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542    0.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5417   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6792   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667    0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1250   -4.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -4.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -1.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5417   -2.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917    0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6792    1.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -2.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7000   -4.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1292   -4.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917    0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4125   -5.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 11  1  0
  3  1  1  0
  4  2  1  0
  5  1  1  0
  6  5  1  0
  7  3  2  0
  8  3  1  0
  9  4  1  0
 10  4  1  0
 11 12  1  0
 12 13  1  0
 13  6  1  0
 14  8  1  0
 15 14  1  0
 16 12  1  0
 17  1  2  0
 18  5  2  0
 19 10  2  0
 20 10  1  0
 21  9  2  0
 22  9  1  0
 23 15  1  0
 24 15  2  0
 25 17  1  0
 26 25  2  0
 27 19  1  0
 28 21  1  0
 29 22  2  0
 30 20  2  0
 31 24  1  0
 32 23  2  0
 33 29  1  0
 34 31  2  0
 35 30  1  0
 26 18  1  0
 34 32  1  0
 35 27  2  0
 33 28  2  0
M  END

Associated Targets(Human)

CCRF-CEM/VCR-1000 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.59Molecular Weight (Monoisotopic): 465.2304AlogP: 5.62#Rotatable Bonds: 12
Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.03CX LogP: 6.17CX LogD: 5.45
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.40

References

1. Fleischer R, Wiese M..  (2003)  Three-dimensional quantitative structure-activity relationship analysis of propafenone-type multidrug resistance modulators: influence of variable selection on test set predictivity.,  46  (23): [PMID:14584949] [10.1021/jm030876r]

Source