Sibirolide A

ID: ALA3594185

PubChem CID: 122182496

Max Phase: Preclinical

Molecular Formula: C15H16O3

Molecular Weight: 244.29

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1[C@H]2C[C@H]2[C@]2(C)CC(=O)C3=C(C)C(=O)O[C@@H]3[C@@H]12

Standard InChI:  InChI=1S/C15H16O3/c1-6-8-4-9(8)15(3)5-10(16)11-7(2)14(17)18-13(11)12(6)15/h8-9,12-13H,1,4-5H2,2-3H3/t8-,9-,12-,13+,15+/m1/s1

Standard InChI Key:  WQYDDKKOUFICFB-UVBAXCRRSA-N

Molfile:  

     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
    2.7140   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3947   -1.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7758   -3.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2851   -2.9666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0835   -2.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3692   -4.1760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5710   -1.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4230    1.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7140    1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5957    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1381    1.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5957    0.0000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6401    0.8361    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4024   -1.7446    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8141   -2.0807    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 16  3  1  0
  2  1  1  0
  1 17  1  0
  2  3  1  0
  2  6  1  0
  3  4  1  0
  4  5  1  0
  5  7  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  6 10  1  0
  1 11  2  0
  9 12  2  0
  8 13  1  0
  5 14  2  0
  3 15  1  6
 17 16  1  0
 18 17  1  0
 16 18  1  0
 17 19  1  1
 16 20  1  1
  2 21  1  1
  6 22  1  6
M  END

Alternative Forms

  1. Parent:

    ALA3594185

    ---

Associated Targets(non-human)

Coxsackievirus B3 (1096 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 244.29Molecular Weight (Monoisotopic): 244.1099AlogP: 2.03#Rotatable Bonds:
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 11.08CX Basic pKa: CX LogP: 1.97CX LogD: 1.97
Aromatic Rings: Heavy Atoms: 18QED Weighted: 0.48Np Likeness Score: 2.88

References

1. Shi YS, Liu YB, Ma SG, Li Y, Qu J, Li L, Yuan SP, Hou Q, Li YH, Jiang JD, Yu SS..  (2015)  Bioactive Sesquiterpenes and Lignans from the Fruits of Xanthium sibiricum.,  78  (7): [PMID:26110443] [10.1021/np500951s]

Source