The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-Chloro-4-(3-isopropyl-1H-indol-5-yloxy)-5-methyl-phenyl]-oxalamic acid ethyl ester ID: ALA359647
PubChem CID: 44391408
Max Phase: Preclinical
Molecular Formula: C22H23ClN2O4
Molecular Weight: 414.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc3[nH]cc(C(C)C)c3c2)c(Cl)c1
Standard InChI: InChI=1S/C22H23ClN2O4/c1-5-28-22(27)21(26)25-14-8-13(4)20(18(23)9-14)29-15-6-7-19-16(10-15)17(11-24-19)12(2)3/h6-12,24H,5H2,1-4H3,(H,25,26)
Standard InChI Key: WSTUKPKFASCSPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-3.5708 0.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0583 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9667 -0.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5708 -0.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0792 0.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0917 -0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -0.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6917 -0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5292 -0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 0.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8042 -0.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 0.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0708 0.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5167 0.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3583 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9542 0.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6917 -1.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8208 1.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0708 -0.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -0.8917 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.3583 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -0.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 1.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6333 1.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2708 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1167 -0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -0.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 8 1 0
5 3 1 0
6 14 1 0
7 6 2 0
8 10 1 0
9 4 1 0
10 16 1 0
11 6 1 0
12 2 2 0
13 7 1 0
14 17 1 0
15 2 1 0
16 11 2 0
17 15 2 0
18 4 2 0
19 9 2 0
20 1 1 0
21 12 1 0
22 7 1 0
23 17 1 0
24 9 1 0
25 11 1 0
26 20 1 0
27 20 1 0
28 24 1 0
29 28 1 0
5 12 1 0
23 21 2 0
10 13 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.89Molecular Weight (Monoisotopic): 414.1346AlogP: 5.55#Rotatable Bonds: 5Polar Surface Area: 80.42Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.81CX Basic pKa: ┄CX LogP: 5.87CX LogD: 5.87Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: -0.96
References 1. Haning H, Woltering M, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Pernerstorfer J.. (2005) Novel heterocyclic thyromimetics., 15 (7): [PMID:15780617 ] [10.1016/j.bmcl.2005.02.028 ]