6-(2,4-Difluorophenyl)-3-(2-(trifluoromethyl)phenyl)-2H-benzo[e][1,3]oxazine-2,4(3H)-dione

ID: ALA3596953

PubChem CID: 71812078

Max Phase: Preclinical

Molecular Formula: C21H10F5NO3

Molecular Weight: 419.31

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1oc2ccc(-c3ccc(F)cc3F)cc2c(=O)n1-c1ccccc1C(F)(F)F

Standard InChI:  InChI=1S/C21H10F5NO3/c22-12-6-7-13(16(23)10-12)11-5-8-18-14(9-11)19(28)27(20(29)30-18)17-4-2-1-3-15(17)21(24,25)26/h1-10H

Standard InChI Key:  DWJQNCKPQJYNGD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2125    0.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1905    0.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2206   -0.4383    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5317    3.6272    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1925    3.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8951    2.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1953    3.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6321   -1.3486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4965    3.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4931    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8926    1.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8985    3.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5065    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    2.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4908    1.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965    3.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5978    4.9516    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5565    3.1529    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5580    4.3528    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 11 17  1  0
  7 20  1  0
 10  9  1  0
  8 18  1  0
 14  2  1  0
 17  3  1  0
  4 18  1  0
 16 10  2  0
 14 20  2  0
 17  9  2  0
 12 25  2  0
  2  5  1  0
 12  8  1  0
 19 11  1  0
 15  6  1  0
  1 14  1  0
 23 15  1  0
 11 12  1  0
 15  7  2  0
 22 24  1  0
  8 21  2  0
  2 23  2  0
 26 16  1  0
 18 22  2  0
  1 21  1  0
  3 26  2  0
  4 19  1  0
 24  1  2  0
 19 13  2  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
  9 27  1  0
M  END

Associated Targets(non-human)

Tnfsf11 Tumor necrosis factor ligand superfamily member 11 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.31Molecular Weight (Monoisotopic): 419.0581AlogP: 4.91#Rotatable Bonds: 2
Polar Surface Area: 52.21Molecular Species: HBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.63CX LogD: 5.63
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -0.99

References

1. Lee CC, Liu FL, Chen CL, Chen TC, Liu FC, Ahmed Ali AA, Chang DM, Huang HS..  (2015)  Novel inhibitors of RANKL-induced osteoclastogenesis: Design, synthesis, and biological evaluation of 6-(2,4-difluorophenyl)-3-phenyl-2H-benzo[e][1,3]oxazine-2,4(3H)-diones.,  23  (15): [PMID:26081760] [10.1016/j.bmc.2015.06.007]

Source