1-((1R,2S)-1-{2-[2-(4-Chloro-phenyl)-benzooxazol-7-yl]-ethyl}-2-hydroxy-propyl)-1H-imidazole-4-carboxylic acid amide

ID: ALA359803

PubChem CID: 10238071

Max Phase: Preclinical

Molecular Formula: C22H21ClN4O3

Molecular Weight: 424.89

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](O)[C@@H](CCc1cccc2nc(-c3ccc(Cl)cc3)oc12)n1cnc(C(N)=O)c1

Standard InChI:  InChI=1S/C22H21ClN4O3/c1-13(28)19(27-11-18(21(24)29)25-12-27)10-7-14-3-2-4-17-20(14)30-22(26-17)15-5-8-16(23)9-6-15/h2-6,8-9,11-13,19,28H,7,10H2,1H3,(H2,24,29)/t13-,19+/m0/s1

Standard InChI Key:  SMFRBBHLVBWHGB-ORAYPTAESA-N

Molfile:  

     RDKit          2D

 30 33  0  0  1  0  0  0  0  0999 V2000
    3.8542    0.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6292    0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3042   -0.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -0.0250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4500    0.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6125    1.3083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9500    0.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6250   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1667    0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9125   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1417    1.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5042   -0.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2167    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042   -0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4292    0.9583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1417   -0.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6292    2.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6000    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1375    2.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0667   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083    2.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0208    2.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2167    2.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0208    3.5875    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.9125   -1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8667   -1.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6250   -1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417   -1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8167   -2.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3 10  1  0
  4  7  1  0
  5  8  1  0
  6  1  1  0
  7  1  2  0
  8 15  2  0
  9  6  2  0
 10  8  1  0
 11  1  1  0
 12  4  1  1
 13  2  1  0
 14 12  1  0
 15 17  1  0
 16 11  2  0
 17 14  1  0
 18 13  2  0
 19 13  1  0
 20 11  1  0
 21 12  1  0
 22 23  1  0
 23 19  2  0
 24 18  1  0
 25 22  1  0
 26 28  1  0
 27 21  1  0
 28 29  2  0
 29 15  1  0
 21 30  1  1
  9  4  1  0
 26 10  2  0
  3  2  2  0
 22 24  2  0
M  END

Associated Targets(Human)

ADA Tclin Adenosine deaminase (129 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.89Molecular Weight (Monoisotopic): 424.1302AlogP: 4.00#Rotatable Bonds: 7
Polar Surface Area: 107.17Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.81CX Basic pKa: 3.23CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -0.69

References

1. Terasaka T, Tsuji K, Kato T, Nakanishi I, Kinoshita T, Kato Y, Kuno M, Inoue T, Tanaka K, Nakamura K..  (2005)  Rational design of non-nucleoside, potent, and orally bioavailable adenosine deaminase inhibitors: predicting enzyme conformational change and metabolism.,  48  (15): [PMID:16033254] [10.1021/jm050413g]

Source