(1H-Imidazol-4-ylmethyl)-(4-phenoxy-benzyl)-(2-p-tolyl-ethyl)-amine

ID: ALA359958

PubChem CID: 44390113

Max Phase: Preclinical

Molecular Formula: C26H27N3O

Molecular Weight: 397.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(CCN(Cc2ccc(Oc3ccccc3)cc2)Cc2c[nH]cn2)cc1

Standard InChI:  InChI=1S/C26H27N3O/c1-21-7-9-22(10-8-21)15-16-29(19-24-17-27-20-28-24)18-23-11-13-26(14-12-23)30-25-5-3-2-4-6-25/h2-14,17,20H,15-16,18-19H2,1H3,(H,27,28)

Standard InChI Key:  IKOZHIDSXHEERB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -3.5875   -1.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8208   -1.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7083   -0.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1333   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8958   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3958   -1.0292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1083   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1625    0.1833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6833   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -0.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0292   -1.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4000   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875    1.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6958    2.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -1.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292    0.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7417   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0292    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4000    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4083    2.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250    2.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6958    3.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8875   -1.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6000   -1.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3167   -0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  2  0
  5  2  2  0
  6  7  1  0
  7  2  1  0
  8 10  1  0
  9  6  1  0
 10 17  2  0
 11  9  1  0
 12  6  1  0
 13 16  1  0
 14  8  1  0
 15 23  1  0
 16 12  1  0
 17 20  1  0
 18 19  2  0
 19 11  1  0
 20 11  2  0
 21 13  2  0
 22 13  1  0
 23 22  2  0
 24 21  1  0
 25 15  1  0
 26 14  2  0
 27 14  1  0
 28 26  1  0
 29 27  2  0
 30 29  1  0
  3  5  1  0
 10 18  1  0
 15 24  2  0
 30 28  2  0
M  END

Associated Targets(Human)

FNTA Tclin Geranylgeranyl transferase type I (851 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.52Molecular Weight (Monoisotopic): 397.2154AlogP: 5.76#Rotatable Bonds: 9
Polar Surface Area: 41.15Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.91CX Basic pKa: 7.44CX LogP: 5.63CX LogD: 5.31
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -0.92

References

1. Saha AK, End DW..  (2005)  Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I.,  15  (6): [PMID:15745827] [10.1016/j.bmcl.2005.01.042]

Source