The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(((5-chloro-2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)amino)methyl)phenyl)acrylamide ID: ALA3601223
Cas Number: 1805787-93-2
PubChem CID: 92042864
Product Number: J647018, Order Now?
Max Phase: Preclinical
Molecular Formula: C26H30ClN7O2
Molecular Weight: 508.03
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(CNc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ncc2Cl)c1
Standard InChI: InChI=1S/C26H30ClN7O2/c1-4-24(35)30-19-7-5-6-18(14-19)16-28-25-21(27)17-29-26(32-25)31-22-9-8-20(15-23(22)36-3)34-12-10-33(2)11-13-34/h4-9,14-15,17H,1,10-13,16H2,2-3H3,(H,30,35)(H2,28,29,31,32)
Standard InChI Key: UGXCBYVBIJACEK-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8934 5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1924 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7897 3.0040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7876 1.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0858 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7474 0.9050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0842 -0.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2934 3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8863 5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5795 7.5047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2791 8.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2762 9.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5739 10.5049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8743 9.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8771 8.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5716 11.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1954 3.0153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2317 3.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
2 8 1 0
8 9 1 0
4 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
9 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 9 1 0
25 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
31 34 1 0
27 35 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.03Molecular Weight (Monoisotopic): 507.2150AlogP: 4.37#Rotatable Bonds: 9Polar Surface Area: 94.65Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.84CX LogP: 4.36CX LogD: 3.78Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.53
References 1. Tan L, Akahane K, McNally R, Reyskens KM, Ficarro SB, Liu S, Herter-Sprie GS, Koyama S, Pattison MJ, Labella K, Johannessen L, Akbay EA, Wong KK, Frank DA, Marto JA, Look TA, Arthur JS, Eck MJ, Gray NS.. (2015) Development of Selective Covalent Janus Kinase 3 Inhibitors., 58 (16): [PMID:26258521 ] [10.1021/acs.jmedchem.5b00710 ]