The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-((R)-sec-Butoxy)-1-(4-chloro-phenyl)-6-methoxy-2-[4-(methyl-piperidin-4-ylmethyl-amino)-phenyl]-1,4-dihydro-2H-isoquinolin-3-one ID: ALA3601319
PubChem CID: 67390247
Max Phase: Preclinical
Molecular Formula: C33H40ClN3O3
Molecular Weight: 562.15
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H](C)Oc1cc2c(cc1OC)CC(=O)N(c1ccc(N(C)CC3CCNCC3)cc1)C2c1ccc(Cl)cc1
Standard InChI: InChI=1S/C33H40ClN3O3/c1-5-22(2)40-31-20-29-25(18-30(31)39-4)19-32(38)37(33(29)24-6-8-26(34)9-7-24)28-12-10-27(11-13-28)36(3)21-23-14-16-35-17-15-23/h6-13,18,20,22-23,33,35H,5,14-17,19,21H2,1-4H3/t22-,33?/m1/s1
Standard InChI Key: NCDHHXTYFKEITD-LWMFVPLKSA-N
Molfile:
RDKit 2D
40 44 0 0 1 0 0 0 0 0999 V2000
6.2387 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6373 3.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0432 -3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0036 7.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 8.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6017 7.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5993 5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3093 9.7517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2721 10.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6114 10.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6168 11.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9171 12.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9195 14.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6217 14.9991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3214 14.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3190 12.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2997 3.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 3.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8978 3.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8954 5.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9337 5.8562 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5952 6.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2974 5.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 6
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 8 2 0
14 15 1 0
15 16 2 0
16 6 1 0
16 17 1 0
17 18 1 0
10 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
9 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
37 39 1 0
39 40 2 0
40 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.15Molecular Weight (Monoisotopic): 561.2758AlogP: 6.64#Rotatable Bonds: 9Polar Surface Area: 54.04Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.35CX LogP: 6.24CX LogD: 3.47Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -0.78
References 1. Holzer P, Masuya K, Furet P, Kallen J, Valat-Stachyra T, Ferretti S, Berghausen J, Bouisset-Leonard M, Buschmann N, Pissot-Soldermann C, Rynn C, Ruetz S, Stutz S, Chène P, Jeay S, Gessier F.. (2015) Discovery of a Dihydroisoquinolinone Derivative (NVP-CGM097): A Highly Potent and Selective MDM2 Inhibitor Undergoing Phase 1 Clinical Trials in p53wt Tumors., 58 (16): [PMID:26181851 ] [10.1021/acs.jmedchem.5b00810 ] 2. (2015) Substituted isoquinolinones and quinazolinones,