Ganoderlactone B

ID: ALA3601516

PubChem CID: 122184973

Max Phase: Preclinical

Molecular Formula: C27H34O6

Molecular Weight: 454.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)C(=O)CC[C@]2(C)C3=C(C(=O)C[C@@H]12)[C@]1(C)C(=O)C[C@H]([C@]2(C)CCC(=O)O2)[C@@]1(C)CC3=O

Standard InChI:  InChI=1S/C27H34O6/c1-23(2)16-11-14(28)22-21(24(16,3)9-7-18(23)30)15(29)13-25(4)17(12-19(31)27(22,25)6)26(5)10-8-20(32)33-26/h16-17H,7-13H2,1-6H3/t16-,17-,24-,25+,26-,27-/m0/s1

Standard InChI Key:  OLACLXTZQVYOIP-LJANSZIASA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -2.9565    0.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0770    6.4573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413    2.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030    2.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6736   -2.8250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8648    5.5022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6930    0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8698   -2.3902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6790   -0.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2209   -2.4390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4380    0.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1792   -1.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0440    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9382   -2.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6404    2.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9895   -3.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9682   -1.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8181    4.0617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625    0.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4997    2.3811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5988    3.2539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3648    5.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3032    2.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4079   -0.5231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4197   -2.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4562    1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1792   -0.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8212   -1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3487   -0.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6790   -1.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3319    1.5371    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030   -0.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625    1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3911    4.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0440    1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 27  1  1  0
 22 18  1  0
 23 35  1  0
 21 34  1  0
  9  1  1  0
 25 28  1  0
 19 24  2  0
 35 13  1  0
 26 20  2  0
 11 26  1  0
 35  3  1  1
 14 17  1  0
 14 16  1  0
 14 30  1  0
 18 21  1  0
 23 21  1  0
 13 29  1  6
  4 26  1  0
 21 15  1  1
 13 19  1  0
 12 14  1  0
 28 32  1  0
  9  7  1  1
  6 22  1  0
 35  4  1  0
 28  8  2  0
 33 23  1  0
 30  5  1  6
 34  6  1  0
 19 33  1  0
 32 13  1  0
 22  2  2  0
 23 31  1  6
 12 10  2  0
 30 25  1  0
 11 32  2  0
  9 30  1  0
 27 12  1  0
  9 11  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3601516

    ---

Associated Targets(non-human)

IMA1 Oligo-1,6-glucosidase (218 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.56Molecular Weight (Monoisotopic): 454.2355AlogP: 3.94#Rotatable Bonds: 1
Polar Surface Area: 94.58Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: 2.80

References

1. Zhao XR, Huo XK, Dong PP, Wang C, Huang SS, Zhang BJ, Zhang HL, Deng S, Liu KX, Ma XC..  (2015)  Inhibitory Effects of Highly Oxygenated Lanostane Derivatives from the Fungus Ganoderma lucidum on P-Glycoprotein and α-Glucosidase.,  78  (8): [PMID:26222905] [10.1021/acs.jnatprod.5b00132]

Source