The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-N-(p-Cyanobenzenesulfonyl)-dimethyl-matrinic butylamine ID: ALA3604433
PubChem CID: 122185704
Max Phase: Preclinical
Molecular Formula: C24H36N4O2S
Molecular Weight: 444.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1S(=O)(=O)c1ccc(C#N)cc1)[C@@H]23
Standard InChI: InChI=1S/C24H36N4O2S/c1-26(2)14-4-3-9-23-22-8-6-16-27-15-5-7-20(24(22)27)18-28(23)31(29,30)21-12-10-19(17-25)11-13-21/h10-13,20,22-24H,3-9,14-16,18H2,1-2H3/t20-,22+,23+,24-/m0/s1
Standard InChI Key: JPTILXVTIDGYLM-RBVMOCNTSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-2.5914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5914 -1.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 -1.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1618 1.2482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1618 1.2482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.8660 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6023 2.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8957 2.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2022 2.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4956 2.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8020 2.9382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8362 2.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8125 4.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 4.5117 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2993 5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 4.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8974 5.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8964 6.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5969 7.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2983 6.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 5.1114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0391 3.9115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1957 7.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2345 8.1165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 13 1 0
2 3 1 0
3 4 1 0
8 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 6
9 15 1 6
8 16 1 6
10 17 1 6
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
11 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
24 31 2 0
24 32 2 0
33 34 3 0
28 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.65Molecular Weight (Monoisotopic): 444.2559AlogP: 3.15#Rotatable Bonds: 7Polar Surface Area: 67.65Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.84CX LogP: 2.91CX LogD: -0.95Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.41
References 1. Wang SG, Kong LY, Li YH, Cheng XY, Su F, Tang S, Bi CW, Jiang JD, Li YH, Song DQ.. (2015) Structure-activity relationship of N-benzenesulfonyl matrinic acid derivatives as a novel class of coxsackievirus B3 inhibitors., 25 (17): [PMID:26112440 ] [10.1016/j.bmcl.2015.06.043 ]