The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-N-(p-Methylcarbonyloxybenzenesulfonyl)-N'-methyl piperazin-1-yl-matrinic butylamine ID: ALA3604438
PubChem CID: 122185709
Max Phase: Preclinical
Molecular Formula: C28H44N4O4S
Molecular Weight: 532.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(S(=O)(=O)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@H]2CCCCN2CCN(C)CC2)cc1
Standard InChI: InChI=1S/C28H44N4O4S/c1-29-17-19-30(20-18-29)14-4-3-9-26-25-8-6-16-31-15-5-7-23(27(25)31)21-32(26)37(34,35)24-12-10-22(11-13-24)28(33)36-2/h10-13,23,25-27H,3-9,14-21H2,1-2H3/t23-,25+,26+,27-/m0/s1
Standard InChI Key: ACRWLAAQPODYOZ-CRJMXQGDSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-2.5914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5914 -1.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 -1.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2957 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2957 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1618 1.2482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1618 1.2482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.8660 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6023 2.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8957 2.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2022 2.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4956 2.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8020 2.9382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 4.5117 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2993 5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 4.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8974 5.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8964 6.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5969 7.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2983 6.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 5.1114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0391 3.9115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1941 7.5185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2348 6.9210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1910 9.0193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2287 9.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0959 2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4001 2.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4106 4.4201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1168 5.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8126 4.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4540 5.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 13 1 0
2 3 1 0
3 4 1 0
8 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 6
9 15 1 6
8 16 1 6
10 17 1 6
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
11 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
22 29 2 0
22 30 2 0
26 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
21 35 1 0
21 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
37 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.75Molecular Weight (Monoisotopic): 532.3083AlogP: 2.75#Rotatable Bonds: 8Polar Surface Area: 73.40Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.02CX LogP: 2.91CX LogD: 0.32Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -0.33
References 1. Wang SG, Kong LY, Li YH, Cheng XY, Su F, Tang S, Bi CW, Jiang JD, Li YH, Song DQ.. (2015) Structure-activity relationship of N-benzenesulfonyl matrinic acid derivatives as a novel class of coxsackievirus B3 inhibitors., 25 (17): [PMID:26112440 ] [10.1016/j.bmcl.2015.06.043 ]