The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-isopropyl-2-methyl-1H-benzo[d]imidazol-6-yl)-N-(5-((4-isopropylpiperazin-1-yl)methyl)pyridin-2-yl)pyrimidin-2-amine ID: ALA3604464
PubChem CID: 122185733
Max Phase: Preclinical
Molecular Formula: C28H36N8
Molecular Weight: 484.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2ccc(-c3ccnc(Nc4ccc(CN5CCN(C(C)C)CC5)cn4)n3)cc2n1C(C)C
Standard InChI: InChI=1S/C28H36N8/c1-19(2)35-14-12-34(13-15-35)18-22-6-9-27(30-17-22)33-28-29-11-10-24(32-28)23-7-8-25-26(16-23)36(20(3)4)21(5)31-25/h6-11,16-17,19-20H,12-15,18H2,1-5H3,(H,29,30,32,33)
Standard InChI Key: LSCLFKMMDSPABA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-8.8133 2.9879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.1115 3.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4114 2.9911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4132 1.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1151 0.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8151 1.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5147 0.7385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2151 1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9144 0.7421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6204 2.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9211 3.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2185 2.9892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3556 2.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3808 3.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7118 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0114 2.9897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.3122 3.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.6095 2.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.6062 1.4839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.3055 0.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0081 1.4897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.9027 0.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.8983 -0.4721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.9443 1.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
10 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
21 23 1 0
20 24 1 0
24 25 1 0
24 26 1 0
3 27 1 0
27 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
31 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.65Molecular Weight (Monoisotopic): 484.3063AlogP: 5.05#Rotatable Bonds: 7Polar Surface Area: 75.00Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.95CX Basic pKa: 8.21CX LogP: 4.43CX LogD: 3.66Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.69
References 1. Sánchez-Martínez C, Gelbert LM, Lallena MJ, de Dios A.. (2015) Cyclin dependent kinase (CDK) inhibitors as anticancer drugs., 25 (17): [PMID:26115571 ] [10.1016/j.bmcl.2015.05.100 ]