(rac)-1-(4-chlorophenyl)-6,7-diethoxy-2-(4-methoxyphenyl)-1,2-dihydroisoquinolin-3(4H)-one

ID: ALA3604658

PubChem CID: 5037958

Max Phase: Preclinical

Molecular Formula: C26H26ClNO4

Molecular Weight: 451.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cc2c(cc1OCC)C(c1ccc(Cl)cc1)N(c1ccc(OC)cc1)C(=O)C2

Standard InChI:  InChI=1S/C26H26ClNO4/c1-4-31-23-14-18-15-25(29)28(20-10-12-21(30-3)13-11-20)26(17-6-8-19(27)9-7-17)22(18)16-24(23)32-5-2/h6-14,16,26H,4-5,15H2,1-3H3

Standard InChI Key:  ICXBLIHPEQODQG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8911    1.5017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8890    3.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8911   -1.5017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8890   -3.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6486    1.3517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2919   -2.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0099   -3.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0151   -5.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2813   -5.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5829   -5.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5882   -3.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2770   -7.1982    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086   -1.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9097   -3.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2093   -3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078   -3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5067   -1.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2071   -0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8096   -3.7478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8475   -3.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9270    3.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9270   -3.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  1  0
  9 11  1  0
 13 14  1  0
  8 13  1  0
  1 15  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  3 16  1  0
 19 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  2 23  1  0
 29 30  1  0
 26 29  1  0
 12 31  1  0
 14 32  1  0
M  END

Associated Targets(Human)

SJSA-1 (970 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TP53 Tchem Tumour suppressor p53/oncoprotein Mdm2 (2075 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.95Molecular Weight (Monoisotopic): 451.1550AlogP: 5.82#Rotatable Bonds: 7
Polar Surface Area: 48.00Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.29CX LogD: 5.29
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -0.62

References

1. Gessier F, Kallen J, Jacoby E, Chène P, Stachyra-Valat T, Ruetz S, Jeay S, Holzer P, Masuya K, Furet P..  (2015)  Discovery of dihydroisoquinolinone derivatives as novel inhibitors of the p53-MDM2 interaction with a distinct binding mode.,  25  (17): [PMID:26141769] [10.1016/j.bmcl.2015.06.058]

Source