(3R,5S,5'R,8R,9S,10S,13S,14S)-4'-benzyl-10,13-dimethyl-5'-(2-methylpropyl)tetradecahydro-6'H-spiro[cyclopenta[a]-phenanthrene-3,2'-[1,4]oxazinane]-6',17(2H)-dione

ID: ALA3605183

PubChem CID: 90085991

Max Phase: Preclinical

Molecular Formula: C33H47NO3

Molecular Weight: 505.74

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@@H]1C(=O)O[C@@]2(CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]43)C2)CN1Cc1ccccc1

Standard InChI:  InChI=1S/C33H47NO3/c1-22(2)18-28-30(36)37-33(21-34(28)20-23-8-6-5-7-9-23)17-16-31(3)24(19-33)10-11-25-26-12-13-29(35)32(26,4)15-14-27(25)31/h5-9,22,24-28H,10-21H2,1-4H3/t24-,25-,26-,27-,28+,31-,32-,33+/m0/s1

Standard InChI Key:  ZXNGALYTDXDNJO-QMVLBYHBSA-N

Molfile:  

     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1406   -2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1405    0.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6406   -2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3905   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6405    0.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3905    1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8905    1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8906   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6405    0.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1406   -2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6406   -2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8906   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1405    0.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1342    1.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5045    1.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3477   -0.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2385   -1.2479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5947   -1.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8906   -1.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1405    1.4151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3906   -1.6160    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1405    1.4151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7327    1.4621    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6331    3.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5549    3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9072    5.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9020    3.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  6
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  1  1  0
  7  9  1  0
  1  8  1  0
  8 11  1  0
 10  9  1  0
 10 11  1  0
 10 14  1  0
 11 12  1  0
 12 13  1  0
 13 15  1  0
 14 15  1  0
 14 17  1  0
 15 19  1  0
 18 16  1  0
 16 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 22 23  2  0
 18 24  1  6
 10 25  1  6
 11 26  1  1
 14 27  1  1
 15 28  1  6
 19 29  1  1
  5 30  2  0
  4 31  1  1
 31 32  1  0
 32 33  1  0
 32 34  1  0
  3 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
M  END

Associated Targets(Human)

LAPC4 (305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hsd17b3 Testosterone 17-beta-dehydrogenase 3 (232 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.74Molecular Weight (Monoisotopic): 505.3556AlogP: 6.81#Rotatable Bonds: 4
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.86CX LogP: 7.40CX LogD: 7.29
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: 1.39

References

1. Djigoué GB, Kenmogne LC, Roy J, Maltais R, Poirier D..  (2015)  Design, chemical synthesis and biological evaluation of 3-spiromorpholinone/3-spirocarbamate androsterone derivatives as inhibitors of 17β-hydroxysteroid dehydrogenase type 3.,  23  (17): [PMID:26277760] [10.1016/j.bmc.2015.07.049]

Source