Methyl(2R)-2-[(3R,8R,9S,10S,13S,14S)-10,13-dimethyl-2',17-dioxohexadecahydro-3'H-spiro[cyclopenta[a]phenanthrene-3,5'-[1,3]oxazolidin]-3'-yl]-4-methylpentanoate

ID: ALA3605186

PubChem CID: 90085992

Max Phase: Preclinical

Molecular Formula: C28H43NO5

Molecular Weight: 473.65

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)[C@@H](CC(C)C)N1C[C@]2(CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]43)C2)OC1=O

Standard InChI:  InChI=1S/C28H43NO5/c1-17(2)14-22(24(31)33-5)29-16-28(34-25(29)32)13-12-26(3)18(15-28)6-7-19-20-8-9-23(30)27(20,4)11-10-21(19)26/h17-22H,6-16H2,1-5H3/t18-,19-,20-,21-,22+,26-,27-,28+/m0/s1

Standard InChI Key:  MAZLGBCIZJGEGL-VMCJABOHSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -4.5500   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7300   -3.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2400   -3.9500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0200   -2.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9700   -1.4700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5500   -0.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1900   -2.8800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2200    0.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9000   -0.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9000   -2.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5400   -2.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7700   -2.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6100    0.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7300   -0.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6700    2.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6400    1.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9800    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9500    0.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3800   -0.3900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3400    0.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4100    2.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7774    3.2724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1242    2.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8889    0.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8998   -3.1300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6016   -0.8200    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6033   -1.0772    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7663    0.6976    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2134   -2.4945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8465   -5.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9626   -6.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3391   -5.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8272   -6.5723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2217   -4.2622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4151   -4.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5702   -7.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8635   -8.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7634   -8.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  1  1  0
  6  8  1  0
  1  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  1  0
  9 13  1  0
 10 11  1  0
 11 12  1  0
 12 14  1  0
 13 14  1  0
 13 16  1  0
 14 18  1  0
 17 15  1  0
 15 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 21 22  2  0
 17 23  1  1
  9 24  1  1
 10 25  1  6
 13 26  1  6
 14 27  1  1
 18 28  1  6
  4 29  2  0
  3 30  1  0
 30 31  1  6
 30 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 31 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3605186

   methyl (2R)-2-[(3R,5S,8R,9S,10S, 13S,14S)-10,13-dimethyl-2',17-dioxohexadecahydro-3'H-spiro[cyclopenta[a]phenanthrene-3,5'-[1,3]oxazolidin-3'-yl]]-4-methylpentanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 473.65

Molecular Weight (Monoisotopic): 473.3141

AlogP: 5.38

#Rotatable Bonds: 4

Polar Surface Area: 72.91

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.52

CX LogD: 5.52

Aromatic Rings: ┄

Heavy Atoms: 34

QED Weighted: 0.51

Np Likeness Score: 1.43

References

1. Djigoué GB, Kenmogne LC, Roy J, Maltais R, Poirier D..  (2015)  Design, chemical synthesis and biological evaluation of 3-spiromorpholinone/3-spirocarbamate androsterone derivatives as inhibitors of 17β-hydroxysteroid dehydrogenase type 3.,  23  (17): [PMID:26277760] [10.1016/j.bmc.2015.07.049]

Source

Source(1):

• Scientific Literature