1-((3aR,6aS)-5-(9-isopropyl-6-(4-(4-methylpiperazin-1-yl)phenylamino)-9H-purin-2-yl)hexahydropyrrolo[3,4-c]pyrrol-2(1H)-yl)prop-2-en-1-one

ID: ALA3608430

PubChem CID: 118073591

Max Phase: Preclinical

Molecular Formula: C28H37N9O

Molecular Weight: 515.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1C[C@@H]2CN(c3nc(Nc4ccc(N5CCN(C)CC5)cc4)c4ncn(C(C)C)c4n3)C[C@@H]2C1

Standard InChI:  InChI=1S/C28H37N9O/c1-5-24(38)35-14-20-16-36(17-21(20)15-35)28-31-26(25-27(32-28)37(18-29-25)19(2)3)30-22-6-8-23(9-7-22)34-12-10-33(4)11-13-34/h5-9,18-21H,1,10-17H2,2-4H3,(H,30,31,32)/t20-,21+

Standard InChI Key:  CBZIPGPDJXMUAK-OYRHEFFESA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -2.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3877   -3.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971    3.0138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2935    3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7556   -2.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9501   -0.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2901    5.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5873    6.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8881    5.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8917    3.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5944    3.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1860    6.0296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1849    7.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4834    8.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7830    7.5317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7842    6.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4858    5.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8218    8.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9621   -1.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2416   -3.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2251   -4.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6049   -3.7635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4195   -2.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9217   -4.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2015   -3.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9531   -5.6776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2563   -4.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4588   -1.1206    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7403   -4.1523    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  2  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  6  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
  1 13  1  0
 13 14  1  0
  3 15  1  0
 15 16  1  0
 16 31  1  0
 30 17  1  0
 17 15  1  0
 14 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 14  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 20 23  1  0
 26 29  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 30 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  2  0
 30 39  1  6
 31 40  1  6
M  END

Associated Targets(Human)

ERBB2 Tclin Epidermal growth factor receptor (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.67Molecular Weight (Monoisotopic): 515.3121AlogP: 2.98#Rotatable Bonds: 6
Polar Surface Area: 85.66Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.97CX LogP: 3.03CX LogD: 2.36
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -1.04

References

1. Abdel-Magid AF..  (2015)  Inhibitors of the Epidermal Growth Factor Receptor (EGFR) May Provide Effective Treatment for Lung Adenocarcinoma.,  (7): [PMID:26191356] [10.1021/acsmedchemlett.5b00231]

Source