The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-fluoro-4-(2-(1-methyl-1H-imidazol-4-yl)thieno[3,2-b]pyridin-7-yloxy)phenyl)-5-(3-methoxyphenyl)-1-phenyl-1H-pyrazole-4-carboxamide ID: ALA3608550
PubChem CID: 122186962
Max Phase: Preclinical
Molecular Formula: C34H25FN6O3S
Molecular Weight: 616.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2c(C(=O)Nc3ccc(Oc4ccnc5cc(-c6cn(C)cn6)sc45)c(F)c3)cnn2-c2ccccc2)c1
Standard InChI: InChI=1S/C34H25FN6O3S/c1-40-19-28(37-20-40)31-17-27-33(45-31)30(13-14-36-27)44-29-12-11-22(16-26(29)35)39-34(42)25-18-38-41(23-8-4-3-5-9-23)32(25)21-7-6-10-24(15-21)43-2/h3-20H,1-2H3,(H,39,42)
Standard InChI Key: HBFSOOUBBFCSKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0305 1.1747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4203 0.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3129 -0.8859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8568 -1.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2308 -1.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5944 -3.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8917 -3.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8881 -5.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5873 -6.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2900 -5.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1845 -6.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.1788 -7.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4752 -8.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1371 -8.1288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2494 -5.8675 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.6096 -9.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0761 -10.0858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.8292 -8.7886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8281 -7.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4860 -10.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6832 -11.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8942 -12.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6025 -14.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1018 -14.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8927 -12.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1843 -11.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0354 -10.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9949 -11.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4103 -12.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8662 -13.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9067 -12.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2848 -14.7287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.4500 -15.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
8 12 1 0
15 17 1 0
11 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 11 1 0
20 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
22 27 1 0
25 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 25 1 0
28 32 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
29 33 1 0
32 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 32 1 0
44 45 1 0
42 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.68Molecular Weight (Monoisotopic): 616.1693AlogP: 7.74#Rotatable Bonds: 8Polar Surface Area: 96.09Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.99CX Basic pKa: 5.27CX LogP: 6.38CX LogD: 6.38Aromatic Rings: 7Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -1.53
References 1. Raeppel F, Raeppel SL, Therrien E.. (2015) Design, synthesis and RON receptor tyrosine kinase inhibitory activity of new head groups analogs of LCRF-0004., 25 (18): [PMID:26243370 ] [10.1016/j.bmcl.2015.07.080 ]