The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-fluoro-4-(2-(1-methyl-1H-imidazol-4-yl)thieno[3,2-b]pyridin-7-yloxy)phenyl)-1-phenyl-5-(pyridin-3-yl)-1H-pyrazole-4-carboxamide ID: ALA3608551
PubChem CID: 122186963
Max Phase: Preclinical
Molecular Formula: C32H22FN7O2S
Molecular Weight: 587.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cnc(-c2cc3nccc(Oc4ccc(NC(=O)c5cnn(-c6ccccc6)c5-c5cccnc5)cc4F)c3s2)c1
Standard InChI: InChI=1S/C32H22FN7O2S/c1-39-18-26(36-19-39)29-15-25-31(43-29)28(11-13-35-25)42-27-10-9-21(14-24(27)33)38-32(41)23-17-37-40(22-7-3-2-4-8-22)30(23)20-6-5-12-34-16-20/h2-19H,1H3,(H,38,41)
Standard InChI Key: CXWRJKJKIGCZER-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0305 1.1747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4203 0.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3129 -0.8859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8568 -1.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2308 -1.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5944 -3.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8917 -3.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8881 -5.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5873 -6.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2900 -5.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1845 -6.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.1788 -7.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4752 -8.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1371 -8.1288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2494 -5.8675 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.6096 -9.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0761 -10.0858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.8292 -8.7886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8281 -7.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4860 -10.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6832 -11.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8942 -12.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6025 -14.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1018 -14.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8927 -12.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1843 -11.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0354 -10.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9949 -11.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4103 -12.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8662 -13.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9067 -12.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
8 12 1 0
15 17 1 0
11 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 11 1 0
20 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
22 27 1 0
25 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 25 1 0
28 32 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
29 33 1 0
32 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.64Molecular Weight (Monoisotopic): 587.1540AlogP: 7.13#Rotatable Bonds: 7Polar Surface Area: 99.75Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.94CX Basic pKa: 5.31CX LogP: 5.32CX LogD: 5.32Aromatic Rings: 7Heavy Atoms: 43QED Weighted: 0.21Np Likeness Score: -1.63
References 1. Raeppel F, Raeppel SL, Therrien E.. (2015) Design, synthesis and RON receptor tyrosine kinase inhibitory activity of new head groups analogs of LCRF-0004., 25 (18): [PMID:26243370 ] [10.1016/j.bmcl.2015.07.080 ]