The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-Cyclopropanecarboxylic acid (1R*,8R*,9R*)-9-(2-{[3-(1H-benzoimidazol-2-yl)-propyl]-methyl-amino}-ethyl)-tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-yl ester ID: ALA3608946
PubChem CID: 122187213
Max Phase: Preclinical
Molecular Formula: C29H35N3O2
Molecular Weight: 457.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(CCCc1nc2ccccc2[nH]1)CC[C@@]1(OC(=O)C2CC2)C[C@@H]2CC[C@H]1c1ccccc12
Standard InChI: InChI=1S/C29H35N3O2/c1-32(17-6-11-27-30-25-9-4-5-10-26(25)31-27)18-16-29(34-28(33)20-12-13-20)19-21-14-15-24(29)23-8-3-2-7-22(21)23/h2-5,7-10,20-21,24H,6,11-19H2,1H3,(H,30,31)/t21-,24-,29+/m0/s1
Standard InChI Key: GERVYTOORWZGGL-RPFOIHMYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
2.7650 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7650 0.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4720 1.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4720 -1.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1591 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1591 0.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1140 1.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4468 0.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4468 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1140 -1.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4053 -2.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7016 -2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7434 -2.3972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7137 0.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7201 1.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0225 2.2570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0289 3.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0594 1.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3314 4.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3378 6.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6403 6.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7809 8.2057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.9925 6.1263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.9918 7.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2390 8.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.9719 9.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4916 9.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.2444 8.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4957 7.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6957 -4.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4177 -0.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9296 0.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1626 1.2238 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3516 -0.5405 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.4383 -5.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9383 -5.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 6
11 12 1 0
12 13 2 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 25 1 0
24 23 1 0
23 21 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
12 30 1 0
10 31 1 0
7 32 1 0
31 32 1 0
7 33 1 6
10 34 1 6
35 30 1 0
36 35 1 0
30 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.62Molecular Weight (Monoisotopic): 457.2729AlogP: 5.57#Rotatable Bonds: 9Polar Surface Area: 58.22Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.54CX Basic pKa: 9.82CX LogP: 5.06CX LogD: 2.66Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.28
References 1. Renneberg D, Hubler F, Rey M, Hess P, Delahaye S, Gatfield J, Iglarz M, Hilpert K.. (2015) Discovery of novel bridged tetrahydronaphthalene derivatives as potent T/L-type calcium channel blockers., 25 (18): [PMID:26231163 ] [10.1016/j.bmcl.2015.07.038 ]