3-(1-(3-(4-phenylpiperidin-1-yl)propyl)piperidin-4-yl)-1H-indole

ID: ALA3609358

PubChem CID: 9844022

Max Phase: Preclinical

Molecular Formula: C27H35N3

Molecular Weight: 401.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(C2CCN(CCCN3CCC(c4c[nH]c5ccccc45)CC3)CC2)cc1

Standard InChI:  InChI=1S/C27H35N3/c1-2-7-22(8-3-1)23-11-17-29(18-12-23)15-6-16-30-19-13-24(14-20-30)26-21-28-27-10-5-4-9-25(26)27/h1-5,7-10,21,23-24,28H,6,11-20H2

Standard InChI Key:  ISYLIFCBVIUBEZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1749    2.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2517    3.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8114    5.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2965    5.4106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2218    4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6621    2.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8593    6.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3455    7.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9084    8.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3946    8.6114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9592   10.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4450   10.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3663    9.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8018    7.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3160    7.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8528    9.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4196   10.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9058   10.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8252    9.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2584    8.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7723    8.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  9 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 22 25  1  0
M  END

Associated Targets(non-human)

Adra1b Alpha-1b adrenergic receptor (2470 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Adra1a Alpha-1a adrenergic receptor (3346 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.60Molecular Weight (Monoisotopic): 401.2831AlogP: 5.62#Rotatable Bonds: 6
Polar Surface Area: 22.27Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.70CX LogP: 4.91CX LogD: 2.31
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.58Np Likeness Score: -0.52

References

1. Hayashi R, Ohmori E, Moriwaki M, Kumagai H, Isogaya M..  (2015)  Indolylpiperidine derivatives as potent and selective α1B adrenoceptor antagonists.,  25  (18): [PMID:26238322] [10.1016/j.bmcl.2015.07.046]

Source