The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(2-((4-isopropylphenyl)amino)-2-oxoacetamido)phenyl)amino)-2-oxo-1-phenylethanesulfonic acid ID: ALA3609375
PubChem CID: 122187567
Max Phase: Preclinical
Molecular Formula: C25H25N3O6S
Molecular Weight: 495.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1ccc(NC(=O)C(=O)Nc2ccc(NC(=O)C(c3ccccc3)S(=O)(=O)O)cc2)cc1
Standard InChI: InChI=1S/C25H25N3O6S/c1-16(2)17-8-10-19(11-9-17)27-24(30)25(31)28-21-14-12-20(13-15-21)26-23(29)22(35(32,33)34)18-6-4-3-5-7-18/h3-16,22H,1-2H3,(H,26,29)(H,27,30)(H,28,31)(H,32,33,34)
Standard InChI Key: YIYXIVBATWWRQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
5.1932 -1.8062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -3.0062 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2321 -3.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 -0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0994 0.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3984 1.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3985 2.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0995 3.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8004 2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1876 -6.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1824 -7.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8808 -8.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5844 -7.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5895 -6.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2322 -2.4063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.6967 3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6950 4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7370 3.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
17 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
4 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 4 1 0
5 2 1 0
2 32 1 0
24 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.56Molecular Weight (Monoisotopic): 495.1464AlogP: 3.95#Rotatable Bonds: 7Polar Surface Area: 141.67Molecular Species: ACIDHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.08CX Basic pKa: ┄CX LogP: 4.22CX LogD: 1.85Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.64
References 1. He R, Yu ZH, Zhang RY, Wu L, Gunawan AM, Lane BS, Shim JS, Zeng LF, He Y, Chen L, Wells CD, Liu JO, Zhang ZY.. (2015) Exploring the Existing Drug Space for Novel pTyr Mimetic and SHP2 Inhibitors., 6 (7): [PMID:26191366 ] [10.1021/acsmedchemlett.5b00118 ]