The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3-fluoro-4-(2-(1-methyl-1H-imidazol-4-yl)thieno[3,2-b]pyridin-7-yloxy)phenyl)-1-phenyl-5,6-dihydropyrazolo[4,3-c]azepin-4(1H)-one ID: ALA3609805
PubChem CID: 122187846
Max Phase: Preclinical
Molecular Formula: C30H21FN6O2S
Molecular Weight: 548.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cnc(-c2cc3nccc(Oc4ccc(N5CC=Cc6c(cnn6-c6ccccc6)C5=O)cc4F)c3s2)c1
Standard InChI: InChI=1S/C30H21FN6O2S/c1-35-17-24(33-18-35)28-15-23-29(40-28)27(11-12-32-23)39-26-10-9-20(14-22(26)31)36-13-5-8-25-21(30(36)38)16-34-37(25)19-6-3-2-4-7-19/h2-12,14-18H,13H2,1H3
Standard InChI Key: BULVKSWQYNUHHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 46 0 0 0 0 0 0 0 0999 V2000
8.5632 -4.5898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5069 -3.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -3.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6260 -5.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1277 -6.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6757 -6.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5717 -7.8752 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9665 -8.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9091 -7.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3344 -9.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6711 -10.5302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4538 -12.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9752 -12.2664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2785 -10.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4430 -13.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1694 -5.6707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1272 -4.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5442 -3.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5048 -2.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0489 -2.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6315 -3.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6709 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3373 -6.1027 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6754 -1.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3672 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3213 1.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7902 1.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9001 -2.9460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9378 0.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8689 -0.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2919 -1.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1640 -0.2295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3608 0.9869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8786 2.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0130 3.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6388 4.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1322 5.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0000 3.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3743 2.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 10 2 0
13 15 1 0
4 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
20 24 1 0
24 25 1 0
25 31 1 0
24 26 1 0
27 28 2 0
28 30 1 0
26 27 1 0
25 29 2 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 30 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.60Molecular Weight (Monoisotopic): 548.1431AlogP: 6.49#Rotatable Bonds: 5Polar Surface Area: 78.07Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.27CX LogP: 5.12CX LogD: 5.12Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.10
References 1. Raeppel SL, Therrien E, Raeppel F.. (2015) Design and synthesis of constrained analogs of LCRF-0004 as potent RON tyrosine kinase inhibitors., 25 (17): [PMID:26112445 ] [10.1016/j.bmcl.2015.06.034 ]