5-(3-fluoro-4-(2-(1-methyl-1H-imidazol-4-yl)thieno[3,2-b]pyridin-7-yloxy)phenyl)-1-phenyl-5,6,7,8-tetrahydropyrazolo[4,3-c]azepin-4(1H)-one

ID: ALA3609807

PubChem CID: 122187848

Max Phase: Preclinical

Molecular Formula: C30H23FN6O2S

Molecular Weight: 550.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1cnc(-c2cc3nccc(Oc4ccc(N5CCCc6c(cnn6-c6ccccc6)C5=O)cc4F)c3s2)c1

Standard InChI:  InChI=1S/C30H23FN6O2S/c1-35-17-24(33-18-35)28-15-23-29(40-28)27(11-12-32-23)39-26-10-9-20(14-22(26)31)36-13-5-8-25-21(30(36)38)16-34-37(25)19-6-3-2-4-7-19/h2-4,6-7,9-12,14-18H,5,8,13H2,1H3

Standard InChI Key:  BXBIAORMFZJTAV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 46  0  0  0  0  0  0  0  0999 V2000
    8.5632   -4.5898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5069   -3.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0548   -3.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6260   -5.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1277   -6.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6757   -6.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5717   -7.8752    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.9665   -8.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9091   -7.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3344   -9.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6711  -10.5302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4538  -12.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9752  -12.2664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2785  -10.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4430  -13.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1694   -5.6707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1272   -4.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5442   -3.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5048   -2.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0489   -2.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6315   -3.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6709   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3373   -6.1027    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.3541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6754   -1.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3672    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3213    1.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7902    1.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9001   -2.9460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9378    0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8689   -0.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2919   -1.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1640   -0.2295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3608    0.9869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8786    2.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0130    3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6388    4.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1322    5.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0000    3.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3743    2.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 10  2  0
 13 15  1  0
  4 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 20 24  1  0
 24 25  1  0
 25 31  1  0
 24 26  1  0
 27 28  1  0
 28 30  1  0
 26 27  1  0
 25 29  2  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 30  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3609807

    ---

Associated Targets(Human)

MST1R Tchem Macrophage-stimulating protein receptor (2327 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MET Tclin Hepatocyte growth factor receptor (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.62Molecular Weight (Monoisotopic): 550.1587AlogP: 6.41#Rotatable Bonds: 5
Polar Surface Area: 78.07Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.27CX LogP: 5.09CX LogD: 5.08
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.42

References

1. Raeppel SL, Therrien E, Raeppel F..  (2015)  Design and synthesis of constrained analogs of LCRF-0004 as potent RON tyrosine kinase inhibitors.,  25  (17): [PMID:26112445] [10.1016/j.bmcl.2015.06.034]

Source