The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S,2S)-2-(2-((3-(1H-benzo[d]imidazol-2-yl)propyl)(methyl)amino)ethyl)-6-fluoro-1-isopropyl-4,4-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl 2-methoxyacetate ID: ALA3609823
PubChem CID: 122187854
Max Phase: Preclinical
Molecular Formula: C31H42FN3O3
Molecular Weight: 523.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCC(=O)O[C@]1(CCN(C)CCCc2nc3ccccc3[nH]2)CC(C)(C)c2cc(F)ccc2[C@@H]1C(C)C
Standard InChI: InChI=1S/C31H42FN3O3/c1-21(2)29-23-14-13-22(32)18-24(23)30(3,4)20-31(29,38-28(36)19-37-6)15-17-35(5)16-9-12-27-33-25-10-7-8-11-26(25)34-27/h7-8,10-11,13-14,18,21,29H,9,12,15-17,19-20H2,1-6H3,(H,33,34)/t29-,31+/m0/s1
Standard InChI Key: CAFYOFMRFOIFOW-IGYGKHONSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2933 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2533 3.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3315 3.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5566 2.2290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8559 2.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8953 2.3807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8563 -0.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8569 -1.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1564 -2.2745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1570 -3.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1956 -1.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4566 -4.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4571 -6.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7567 -6.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8917 -8.2338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1114 -6.1592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1063 -7.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3486 -8.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0764 -9.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5961 -9.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3538 -8.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6103 -7.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2433 -2.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3495 -2.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8558 4.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1550 5.2325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1549 6.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
2 11 1 0
10 12 1 6
12 13 1 0
12 14 1 0
9 15 1 6
15 16 1 0
16 17 2 0
9 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 29 1 0
28 27 1 0
27 25 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
7 34 1 0
7 35 1 0
16 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.69Molecular Weight (Monoisotopic): 523.3210AlogP: 6.01#Rotatable Bonds: 11Polar Surface Area: 67.45Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.54CX Basic pKa: 9.82CX LogP: 5.74CX LogD: 3.34Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.45
References 1. Renneberg D, Hubler F, Rey M, Hess P, Delahaye S, Gatfield J, Iglarz M, Hilpert K.. (2015) Discovery of novel bridged tetrahydronaphthalene derivatives as potent T/L-type calcium channel blockers., 25 (18): [PMID:26231163 ] [10.1016/j.bmcl.2015.07.038 ]