(1S,2S)-2-(2-((3-(1H-benzo[d]imidazol-2-yl)propyl)(methyl)amino)ethyl)-6-fluoro-1-isopropyl-4,4-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl 2-methoxyacetate

ID: ALA3609823

PubChem CID: 122187854

Max Phase: Preclinical

Molecular Formula: C31H42FN3O3

Molecular Weight: 523.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCC(=O)O[C@]1(CCN(C)CCCc2nc3ccccc3[nH]2)CC(C)(C)c2cc(F)ccc2[C@@H]1C(C)C

Standard InChI:  InChI=1S/C31H42FN3O3/c1-21(2)29-23-14-13-22(32)18-24(23)30(3,4)20-31(29,38-28(36)19-37-6)15-17-35(5)16-9-12-27-33-25-10-7-8-11-26(25)34-27/h7-8,10-11,13-14,18,21,29H,9,12,15-17,19-20H2,1-6H3,(H,33,34)/t29-,31+/m0/s1

Standard InChI Key:  CAFYOFMRFOIFOW-IGYGKHONSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6486   -1.3517    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2933    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2533    3.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3315    3.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5566    2.2290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8559    2.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8953    2.3807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8563   -0.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8569   -1.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1564   -2.2745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1570   -3.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1956   -1.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4566   -4.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4571   -6.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7567   -6.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8917   -8.2338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1114   -6.1592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1063   -7.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3486   -8.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0764   -9.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5961   -9.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3538   -8.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6103   -7.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2433   -2.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3495   -2.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8558    4.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1550    5.2325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1549    6.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  2 11  1  0
 10 12  1  6
 12 13  1  0
 12 14  1  0
  9 15  1  6
 15 16  1  0
 16 17  2  0
  9 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 29  1  0
 28 27  1  0
 27 25  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
  7 34  1  0
  7 35  1  0
 16 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3609823

    ---

Associated Targets(Human)

CACNA1C Tclin Voltage-gated L-type calcium channel alpha-1C subunit (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.69Molecular Weight (Monoisotopic): 523.3210AlogP: 6.01#Rotatable Bonds: 11
Polar Surface Area: 67.45Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.54CX Basic pKa: 9.82CX LogP: 5.74CX LogD: 3.34
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.45

References

1. Renneberg D, Hubler F, Rey M, Hess P, Delahaye S, Gatfield J, Iglarz M, Hilpert K..  (2015)  Discovery of novel bridged tetrahydronaphthalene derivatives as potent T/L-type calcium channel blockers.,  25  (18): [PMID:26231163] [10.1016/j.bmcl.2015.07.038]

Source