The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(12-(((R,S)-7-Hydroxychroman-2-yl)methylamino)dodecyl)-3-((S)-1-methylpyrrolidin-2-yl)pyridinium bromide ID: ALA3612361
PubChem CID: 122188159
Max Phase: Preclinical
Molecular Formula: C32H50BrN3O2
Molecular Weight: 508.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCC[C@H]1c1ccc[n+](CCCCCCCCCCCCNCC2CCc3ccc(O)cc3O2)c1.[Br-]
Standard InChI: InChI=1S/C32H49N3O2.BrH/c1-34-21-13-15-31(34)28-14-12-23-35(26-28)22-11-9-7-5-3-2-4-6-8-10-20-33-25-30-19-17-27-16-18-29(36)24-32(27)37-30;/h12,14,16,18,23-24,26,30-31,33H,2-11,13,15,17,19-22,25H2,1H3;1H/t30?,31-;/m0./s1
Standard InChI Key: ZBYQPTKAJYPXPW-VBZSYHMBSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
6.3926 0.9773 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 0.7445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-27.6181 -1.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-26.1503 -0.7633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-26.0099 0.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-27.3603 1.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-28.3659 0.2276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-25.2551 -1.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-24.7102 1.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-23.4112 0.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-22.1120 1.4672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-22.1119 2.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-23.4109 3.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-24.7100 2.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.8108 0.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.5120 1.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.2108 0.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.9120 1.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.6109 0.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.3121 1.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0109 0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7121 1.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4109 0.7361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1121 1.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8109 0.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5121 1.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
4 7 1 0
5 9 1 0
8 6 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
16 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 21 1 1
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 2 1 0
M CHG 2 1 -1 23 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.77Molecular Weight (Monoisotopic): 508.3898AlogP: 6.33#Rotatable Bonds: 16Polar Surface Area: 48.61Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.56CX Basic pKa: 10.20CX LogP: 2.25CX LogD: 0.02Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: 0.48
References 1. Matera C, Pucci L, Fiorentini C, Fucile S, Missale C, Grazioso G, Clementi F, Zoli M, De Amici M, Gotti C, Dallanoce C.. (2015) Bifunctional compounds targeting both D2 and non-α7 nACh receptors: design, synthesis and pharmacological characterization., 101 [PMID:26164842 ] [10.1016/j.ejmech.2015.06.039 ]