N-[(2S,4aS,7aR,12aR,14R)-5-(cyclopropylmethyl)-9-hydroxy-2,3,4,4a,5,6,7,12-octahydro-1H-2,7a-ethanoindeno[1,2-d]-quinolin-14-yl]-N-methyl-3-phenylpropanamide hydrochloride

ID: ALA3613172

PubChem CID: 122188803

Max Phase: Preclinical

Molecular Formula: C32H41ClN2O2

Molecular Weight: 484.68

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C(=O)CCc1ccccc1)[C@@H]1C[C@@]23CCN(CC4CC4)[C@H]4CC[C@@H]1C[C@]42Cc1ccc(O)cc13.Cl

Standard InChI:  InChI=1S/C32H40N2O2.ClH/c1-33(30(36)14-9-22-5-3-2-4-6-22)28-20-31-15-16-34(21-23-7-8-23)29-13-11-25(28)19-32(29,31)18-24-10-12-26(35)17-27(24)31;/h2-6,10,12,17,23,25,28-29,35H,7-9,11,13-16,18-21H2,1H3;1H/t25-,28-,29+,31-,32-;/m1./s1

Standard InChI Key:  LNQRQQNRENNENZ-ZKLLXXQBSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    5.7754   -6.8492    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4434   -5.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7224   -6.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0406   -5.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0799   -3.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4827   -3.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6002   -4.9517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5871   -3.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1022   -2.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2931   -5.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1883   -4.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3115   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8137   -7.2596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8037   -8.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3631   -7.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9804   -8.1526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3227   -9.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3127  -10.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8318  -12.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6734   -6.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0078   -7.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7410   -8.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4246   -7.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0997   -5.8333    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0753   -4.8404    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8196  -13.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3360  -14.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8646  -15.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1233  -14.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3603  -12.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8 13  1  0
  8  9  1  0
 10  9  1  0
 10 11  1  0
 12 11  1  6
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 19  1  0
 10 17  1  0
 19 18  1  0
 18 17  1  0
 19  7  1  6
 12 19  1  0
  5 20  1  0
 17 21  1  6
 21 22  1  0
 21 23  1  0
 22 24  2  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 30 29  1  0
 31 30  1  0
 29 31  1  0
 12 32  1  0
 32  2  1  0
 10 33  1  6
 13 34  1  1
 27 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 27  1  0
M  END

Associated Targets(non-human)

Oprd1 Delta opioid receptor (3127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRM1 Mu opioid receptor (3620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprk1 Kappa opioid receptor (991 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.3090AlogP: 5.32#Rotatable Bonds: 6
Polar Surface Area: 43.78Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.64CX Basic pKa: 10.71CX LogP: 4.15CX LogD: 2.26
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.60Np Likeness Score: 0.68

References

1. Nakajima R, Yamamoto N, Hirayama S, Iwai T, Saitoh A, Nagumo Y, Fujii H, Nagase H..  (2015)  Synthesis of new opioid derivatives with a propellane skeleton and their pharmacologies: Part 5, novel pentacyclic propellane derivatives with a 6-amide side chain.,  23  (19): [PMID:26346669] [10.1016/j.bmc.2015.08.036]

Source