The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E/Z)-[5-(4-{2-[(naphthalene-2-carbonyl)amino]ethylcarbamoyl}phenoxy)adamantan-2-yl]acetic acid ID: ALA3613343
PubChem CID: 122188927
Max Phase: Preclinical
Molecular Formula: C32H34N2O5
Molecular Weight: 526.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC1C2CC3CC1CC(Oc1ccc(C(=O)NCCNC(=O)c4ccc5ccccc5c4)cc1)(C3)C2
Standard InChI: InChI=1S/C32H34N2O5/c35-29(36)16-28-25-13-20-14-26(28)19-32(17-20,18-25)39-27-9-7-22(8-10-27)30(37)33-11-12-34-31(38)24-6-5-21-3-1-2-4-23(21)15-24/h1-10,15,20,25-26,28H,11-14,16-19H2,(H,33,37)(H,34,38)(H,35,36)
Standard InChI Key: VQKUNGNAWOVCCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
5.7129 4.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5179 2.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5179 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8516 17.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1714 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7356 15.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9912 1.1391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0235 13.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7572 15.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5639 7.8314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1155 2.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8341 5.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9743 18.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9734 1.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9045 11.7882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5445 -0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3420 5.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6074 2.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2987 -1.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1714 2.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2248 16.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4449 6.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8583 17.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6384 6.7411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7286 3.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0996 2.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4703 18.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2937 10.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1747 9.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3691 16.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1237 14.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1284 -0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8299 12.8785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6343 14.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3300 0.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9239 0.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0862 -2.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9724 -3.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0296 -3.3620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21 4 1 0
23 6 1 0
17 25 1 0
30 9 2 0
2 3 1 0
1 12 1 0
23 30 1 0
8 15 1 0
3 35 1 0
22 12 1 0
18 7 1 0
18 26 1 0
20 5 1 0
27 23 2 0
11 2 1 0
14 36 1 0
5 32 1 0
13 27 1 0
11 20 1 0
32 19 1 0
35 5 1 0
3 7 1 0
15 28 1 0
34 8 1 0
22 24 2 0
25 18 2 0
4 13 2 0
14 11 1 0
6 21 2 0
8 33 2 0
12 17 2 0
10 22 1 0
28 29 1 0
16 3 1 0
31 6 1 0
36 16 1 0
9 34 1 0
29 10 1 0
34 31 2 0
26 1 2 0
36 32 1 0
19 37 1 0
37 38 1 0
37 39 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.63Molecular Weight (Monoisotopic): 526.2468AlogP: 5.05#Rotatable Bonds: 9Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.15CX Basic pKa: ┄CX LogP: 4.26CX LogD: 1.19Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: -0.06
References 1. Pagire SH, Pagire HS, Lee GB, Han SJ, Kwak HJ, Kim JY, Kim KY, Rhee SD, Ryu JI, Song JS, Bae MA, Park MJ, Kim D, Lee DH, Ahn JH.. (2015) Discovery and optimization of adamantane carboxylic acid derivatives as potent diacylglycerol acyltransferase 1 inhibitors for the potential treatment of obesity and diabetes., 101 [PMID:26218650 ] [10.1016/j.ejmech.2015.06.043 ]