The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(4-{2-[(2'-methylbiphenyl-4-carbonyl)amino]ethylcarbamoyl}phenoxy)adamantane-1-carboxylic acid ID: ALA3613351
PubChem CID: 122188931
Max Phase: Preclinical
Molecular Formula: C34H36N2O5
Molecular Weight: 552.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1-c1ccc(C(=O)NCCNC(=O)c2ccc(O[C@H]3C4CC5CC3C[C@](C(=O)O)(C5)C4)cc2)cc1
Standard InChI: InChI=1S/C34H36N2O5/c1-21-4-2-3-5-29(21)23-6-8-24(9-7-23)31(37)35-14-15-36-32(38)25-10-12-28(13-11-25)41-30-26-16-22-17-27(30)20-34(18-22,19-26)33(39)40/h2-13,22,26-27,30H,14-20H2,1H3,(H,35,37)(H,36,38)(H,39,40)/t22?,26?,27?,30-,34-
Standard InChI Key: JNHUICIANQTFML-DVMICJFOSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
1.5179 2.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5179 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1155 2.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3300 0.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1714 2.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1714 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9734 1.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9239 0.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5445 -0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1284 -0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9927 1.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6839 0.1425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4970 2.2123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2986 -1.1348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6922 -0.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8727 -1.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2645 -0.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4759 0.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2955 1.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9037 0.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8673 1.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8129 0.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0767 2.5897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.4681 3.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6775 4.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0689 5.2011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.2783 6.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.6697 7.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.3328 7.4260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.8812 8.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.2730 9.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.4534 8.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.2420 6.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8502 6.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.8458 8.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.0249 8.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.4175 8.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.6312 10.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.4523 10.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.0597 10.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.1166 11.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
2 11 1 6
11 12 2 0
11 13 1 0
10 14 1 1
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 28 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
32 35 1 0
40 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.67Molecular Weight (Monoisotopic): 552.2624AlogP: 5.48#Rotatable Bonds: 9Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.05CX Basic pKa: ┄CX LogP: 5.59CX LogD: 2.47Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -0.25
References 1. Pagire SH, Pagire HS, Lee GB, Han SJ, Kwak HJ, Kim JY, Kim KY, Rhee SD, Ryu JI, Song JS, Bae MA, Park MJ, Kim D, Lee DH, Ahn JH.. (2015) Discovery and optimization of adamantane carboxylic acid derivatives as potent diacylglycerol acyltransferase 1 inhibitors for the potential treatment of obesity and diabetes., 101 [PMID:26218650 ] [10.1016/j.ejmech.2015.06.043 ]