The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(4-{2-[(2'-trifluoromethylbiphenyl-4-carbonyl)amino]ethylcarbamoyl}phenoxy)-adamantane-1-carboxylic acid ID: ALA3613352
PubChem CID: 122188932
Max Phase: Preclinical
Molecular Formula: C34H33F3N2O5
Molecular Weight: 606.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCNC(=O)c1ccc(-c2ccccc2C(F)(F)F)cc1)c1ccc(O[C@H]2C3CC4CC2C[C@](C(=O)O)(C4)C3)cc1
Standard InChI: InChI=1S/C34H33F3N2O5/c35-34(36,37)28-4-2-1-3-27(28)21-5-7-22(8-6-21)30(40)38-13-14-39-31(41)23-9-11-26(12-10-23)44-29-24-15-20-16-25(29)19-33(17-20,18-24)32(42)43/h1-12,20,24-25,29H,13-19H2,(H,38,40)(H,39,41)(H,42,43)/t20?,24?,25?,29-,33-
Standard InChI Key: DFLGGVGMBOPGNL-OWZKXTJZSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
1.5179 2.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5179 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1155 2.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3300 0.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1714 2.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1714 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9734 1.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9239 0.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5445 -0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1284 -0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9927 1.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6839 0.1425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4970 2.2123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2986 -1.1348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6922 -0.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8727 -1.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2645 -0.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4759 0.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2955 1.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9037 0.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8673 1.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8129 0.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0767 2.5897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.4681 3.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6775 4.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0689 5.2011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.2783 6.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.6697 7.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.3328 7.4260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.8812 8.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.2730 9.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.4534 8.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.2420 6.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8502 6.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.8458 8.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.0249 8.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.4175 8.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.6312 10.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.4523 10.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.0597 10.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8802 11.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.0505 12.5290 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-15.7662 10.8951 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-15.9367 12.0827 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
2 11 1 6
11 12 2 0
11 13 1 0
10 14 1 1
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 28 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
32 35 1 0
40 41 1 0
41 42 1 0
41 43 1 0
41 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 606.64Molecular Weight (Monoisotopic): 606.2342AlogP: 6.19#Rotatable Bonds: 9Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.05CX Basic pKa: ┄CX LogP: 5.96CX LogD: 2.83Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.25Np Likeness Score: -0.36
References 1. Pagire SH, Pagire HS, Lee GB, Han SJ, Kwak HJ, Kim JY, Kim KY, Rhee SD, Ryu JI, Song JS, Bae MA, Park MJ, Kim D, Lee DH, Ahn JH.. (2015) Discovery and optimization of adamantane carboxylic acid derivatives as potent diacylglycerol acyltransferase 1 inhibitors for the potential treatment of obesity and diabetes., 101 [PMID:26218650 ] [10.1016/j.ejmech.2015.06.043 ]