5-(2,2-diphenylacetyl)-1-(4-methoxy-3-methylbenzyl)-3a,4,5,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid

ID: ALA3613974

PubChem CID: 122189454

Max Phase: Preclinical

Molecular Formula: C30H31N3O4

Molecular Weight: 497.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CN2C=NC3CN(C(=O)C(c4ccccc4)c4ccccc4)C(C(=O)O)CC32)cc1C

Standard InChI:  InChI=1S/C30H31N3O4/c1-20-15-21(13-14-27(20)37-2)17-32-19-31-24-18-33(26(30(35)36)16-25(24)32)29(34)28(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-15,19,24-26,28H,16-18H2,1-2H3,(H,35,36)

Standard InChI Key:  PEHBGEUHZVBQKM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    6.5944   -3.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5991   -4.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1295   -4.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6506   -1.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1201   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0641   -3.8351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4418   -4.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9164   -1.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267    2.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6549    0.8867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300    3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3308    3.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9402    5.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2443    5.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5383    5.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5281    3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2240    2.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3362    5.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0400    6.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2618    5.2592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2673    3.7593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0289    3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187   -1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6549   -0.8867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6251   -2.6919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 12  1  0
 11  8  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  1 17  1  0
 17 18  1  0
  6 19  1  0
 14 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 21 24  1  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 24 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 24  1  0
 35 36  1  0
 35 37  2  0
 15 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3613974

    ---

Associated Targets(non-human)

Agtr2 Angiotensin II type 2 (AT-2) receptor (803 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.60Molecular Weight (Monoisotopic): 497.2315AlogP: 4.10#Rotatable Bonds: 7
Polar Surface Area: 82.44Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.53CX Basic pKa: 8.06CX LogP: 2.47CX LogD: 2.39
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -0.34

References

1. Dymińska L..  (2015)  Imidazopyridines as a source of biological activity and their pharmacological potentials-Infrared and Raman spectroscopic evidence of their content in pharmaceuticals and plant materials.,  23  (18): [PMID:26314922] [10.1016/j.bmc.2015.07.045]

Source