The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2,2-diphenylacetyl)-1-(4-methoxy-3-methylbenzyl)-3a,4,5,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid ID: ALA3613974
PubChem CID: 122189454
Max Phase: Preclinical
Molecular Formula: C30H31N3O4
Molecular Weight: 497.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN2C=NC3CN(C(=O)C(c4ccccc4)c4ccccc4)C(C(=O)O)CC32)cc1C
Standard InChI: InChI=1S/C30H31N3O4/c1-20-15-21(13-14-27(20)37-2)17-32-19-31-24-18-33(26(30(35)36)16-25(24)32)29(34)28(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-15,19,24-26,28H,16-18H2,1-2H3,(H,35,36)
Standard InChI Key: PEHBGEUHZVBQKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
6.5944 -3.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5991 -4.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1295 -4.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6506 -1.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1201 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0641 -3.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4418 -4.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9164 -1.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6549 0.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 3.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3308 3.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9402 5.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2443 5.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5383 5.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5281 3.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2240 2.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3362 5.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0400 6.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2618 5.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2673 3.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0289 3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6549 -0.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6251 -2.6919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 12 1 0
11 8 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
1 17 1 0
17 18 1 0
6 19 1 0
14 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
21 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
24 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 24 1 0
35 36 1 0
35 37 2 0
15 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.60Molecular Weight (Monoisotopic): 497.2315AlogP: 4.10#Rotatable Bonds: 7Polar Surface Area: 82.44Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.53CX Basic pKa: 8.06CX LogP: 2.47CX LogD: 2.39Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -0.34
References 1. Dymińska L.. (2015) Imidazopyridines as a source of biological activity and their pharmacological potentials-Infrared and Raman spectroscopic evidence of their content in pharmaceuticals and plant materials., 23 (18): [PMID:26314922 ] [10.1016/j.bmc.2015.07.045 ]