3-(1H-Imidazol-4-yl)-3-[(4-phenoxy-benzyl)-(4-phenyl-butyl)-amino]-propionic acid

ID: ALA361521

PubChem CID: 44390087

Max Phase: Preclinical

Molecular Formula: C29H31N3O3

Molecular Weight: 469.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC(c1c[nH]cn1)N(CCCCc1ccccc1)Cc1ccc(Oc2ccccc2)cc1

Standard InChI:  InChI=1S/C29H31N3O3/c33-29(34)19-28(27-20-30-22-31-27)32(18-8-7-11-23-9-3-1-4-10-23)21-24-14-16-26(17-15-24)35-25-12-5-2-6-13-25/h1-6,9-10,12-17,20,22,28H,7-8,11,18-19,21H2,(H,30,31)(H,33,34)

Standard InChI Key:  MARYRVHUZOQJMX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -2.9375   -0.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2250   -0.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5750   -0.8417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2250   -1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5125   -0.3292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9375   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0500    0.3958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2833   -0.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2250    0.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5208    0.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6500   -1.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3292    2.1708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8083    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6167    1.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9375   -2.8042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500    1.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8125    1.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0875    0.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1000    2.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6250    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7958   -0.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500   -0.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7500    2.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500    0.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7542   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0875   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6250   -0.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7667   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4750   -0.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4667    1.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625    0.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4792   -1.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4750    0.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  2  1  0
  6  4  1  0
  7  9  1  0
  8  3  2  0
  9  1  2  0
 10  5  1  0
 11  6  2  0
 12 14  1  0
 13 10  1  0
 14 20  2  0
 15  6  1  0
 16 12  1  0
 17 13  1  0
 18 13  2  0
 19 17  2  0
 20 18  1  0
 21  5  1  0
 22 23  1  0
 23 29  1  0
 24 16  1  0
 25 16  2  0
 26 22  1  0
 27 22  2  0
 28 21  1  0
 29 28  1  0
 30 27  1  0
 31 26  2  0
 32 24  2  0
 33 25  1  0
 34 30  2  0
 35 33  2  0
  8  7  1  0
 14 19  1  0
 34 31  1  0
 35 32  1  0
M  END

Associated Targets(Human)

FNTA Tclin Geranylgeranyl transferase type I (851 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.59Molecular Weight (Monoisotopic): 469.2365AlogP: 6.24#Rotatable Bonds: 13
Polar Surface Area: 78.45Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.12CX Basic pKa: 7.84CX LogP: 3.41CX LogD: 3.30
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -0.41

References

1. Saha AK, End DW..  (2005)  Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I.,  15  (6): [PMID:15745827] [10.1016/j.bmcl.2005.01.042]

Source