The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1H-Imidazol-4-yl)-3-[(4-phenoxy-benzyl)-(4-phenyl-butyl)-amino]-propionic acid ID: ALA361521
PubChem CID: 44390087
Max Phase: Preclinical
Molecular Formula: C29H31N3O3
Molecular Weight: 469.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC(c1c[nH]cn1)N(CCCCc1ccccc1)Cc1ccc(Oc2ccccc2)cc1
Standard InChI: InChI=1S/C29H31N3O3/c33-29(34)19-28(27-20-30-22-31-27)32(18-8-7-11-23-9-3-1-4-10-23)21-24-14-16-26(17-15-24)35-25-12-5-2-6-13-25/h1-6,9-10,12-17,20,22,28H,7-8,11,18-19,21H2,(H,30,31)(H,33,34)
Standard InChI Key: MARYRVHUZOQJMX-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-2.9375 -0.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2250 -0.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5750 -0.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2250 -1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5125 -0.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9375 -1.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0500 0.3958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2833 -0.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2250 0.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5208 0.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6500 -1.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 2.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8083 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 1.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9375 -2.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 1.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8125 1.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0875 0.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1000 2.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7958 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3375 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7500 2.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 0.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7542 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0875 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7667 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4750 -0.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 1.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7625 0.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4792 -1.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4750 0.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 2 1 0
6 4 1 0
7 9 1 0
8 3 2 0
9 1 2 0
10 5 1 0
11 6 2 0
12 14 1 0
13 10 1 0
14 20 2 0
15 6 1 0
16 12 1 0
17 13 1 0
18 13 2 0
19 17 2 0
20 18 1 0
21 5 1 0
22 23 1 0
23 29 1 0
24 16 1 0
25 16 2 0
26 22 1 0
27 22 2 0
28 21 1 0
29 28 1 0
30 27 1 0
31 26 2 0
32 24 2 0
33 25 1 0
34 30 2 0
35 33 2 0
8 7 1 0
14 19 1 0
34 31 1 0
35 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.59Molecular Weight (Monoisotopic): 469.2365AlogP: 6.24#Rotatable Bonds: 13Polar Surface Area: 78.45Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.12CX Basic pKa: 7.84CX LogP: 3.41CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -0.41
References 1. Saha AK, End DW.. (2005) Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I., 15 (6): [PMID:15745827 ] [10.1016/j.bmcl.2005.01.042 ]