Ethyl 4-(4-methoxyphenyl)-2-methyl-4H-pyrimido[2,1-b][1,3]benzothiazole-3-carboxylate

ID: ALA3618296

PubChem CID: 122190932

Max Phase: Preclinical

Molecular Formula: C21H20N2O2S

Molecular Weight: 364.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(=O)C1=C(C)N=C2Sc3ccccc3N2C1c1ccc(OC)cc1

Standard InChI:  InChI=1S/C21H20N2O2S/c1-4-17(24)19-13(2)22-21-23(16-7-5-6-8-18(16)26-21)20(19)14-9-11-15(25-3)12-10-14/h5-12,20H,4H2,1-3H3

Standard InChI Key:  JHXLSEUGSAVNSQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    3.7663    5.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915   -1.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0387    1.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3375    0.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7006   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7006    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1691    3.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4684    3.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274    0.8244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7672    3.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4668    6.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732   -1.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.3190    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0406    2.7727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7737   -1.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1682    5.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3779    1.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4689    7.5408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5086    8.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  3  1  0
  6  7  1  0
  9  2  1  0
 13 11  1  0
 17 21  1  0
 10 23  1  0
  1 13  2  0
 21 12  1  0
  3 11  1  0
 12  8  1  0
 18  3  1  0
 15 16  1  0
 18  4  1  0
  2  6  2  0
 19  9  1  0
 11 10  2  0
 23 14  2  0
 21  9  2  0
  8 19  1  0
  4  5  1  0
 18 15  2  0
 14  1  1  0
 16  8  2  0
  7 17  2  0
  4 20  2  0
 15 22  1  0
  5 24  1  0
 14 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3618296

    ---

Associated Targets(Human)

MYLK Tchem Myosin light chain kinase, smooth muscle (1267 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.47Molecular Weight (Monoisotopic): 364.1245AlogP: 4.97#Rotatable Bonds: 4
Polar Surface Area: 41.90Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.43CX LogP: 4.69CX LogD: 4.69
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.77Np Likeness Score: -1.00

References

1. Chikhale R, Thorat S, Pant A, Jadhav A, Thatipamula KC, Bansode R, Bhargavi G, Karodia N, Rajasekharan MV, Paradkar A, Khedekar P..  (2015)  Design, synthesis and pharmacological evaluation of pyrimidobenzothiazole-3-carboxylate derivatives as selective L-type calcium channel blockers.,  23  (20): [PMID:26385444] [10.1016/j.bmc.2015.09.009]

Source