The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-beta-D-maltosyl-4-(2',4'-dihydrooxyphenyl)-butane ID: ALA3618460
PubChem CID: 71768561
Max Phase: Preclinical
Molecular Formula: C22H34O13
Molecular Weight: 506.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCc1ccc(O)cc1O)O[C@@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C22H34O13/c1-9(2-3-10-4-5-11(25)6-12(10)26)32-21-19(31)17(29)20(14(8-24)34-21)35-22-18(30)16(28)15(27)13(7-23)33-22/h4-6,9,13-31H,2-3,7-8H2,1H3/t9-,13-,14-,15-,16+,17-,18-,19-,20-,21-,22-/m1/s1
Standard InChI Key: ZRDADUROYMLJRH-MWEXSEADSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
5.1890 6.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5852 7.2060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4243 5.7498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8941 3.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8898 5.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5887 6.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2918 5.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2961 3.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 3.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6046 1.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9871 6.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9829 7.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6817 8.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3848 7.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3890 6.0170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6902 5.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0204 8.1273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0898 5.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7890 6.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4898 5.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4912 4.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6936 4.0707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5687 0.8994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5681 4.5182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8659 3.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8635 2.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5633 1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2655 2.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3926 1.7823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5614 0.3182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9018 1.6645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1653 4.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1655 5.7172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3057 4.7494 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 6
6 1 1 6
7 2 1 1
8 3 1 6
9 4 1 1
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
21 22 1 1
21 1 1 0
17 23 1 0
11 24 1 0
25 4 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 6
29 32 1 1
28 33 1 6
27 34 1 1
34 35 1 0
25 36 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.50Molecular Weight (Monoisotopic): 506.1999AlogP: -2.94#Rotatable Bonds: 9Polar Surface Area: 218.99Molecular Species: NEUTRALHBA: 13HBD: 9#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.54CX Basic pKa: ┄CX LogP: -1.79CX LogD: -1.80Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.16Np Likeness Score: 1.75