The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-pyridyl-cyanoguanidine derivative ID: ALA362089
PubChem CID: 53321722
Max Phase: Preclinical
Molecular Formula: C30H45Cl3N6O4
Molecular Weight: 588.17
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](COC(=O)OCCCCCCCCCN)cc1.[Cl-]
Standard InChI: InChI=1S/C30H43ClN6O4.2ClH/c31-26-12-14-28(15-13-26)39-22-10-7-5-9-19-34-29(35-24-33)36-27-16-20-37(21-17-27)25-41-30(38)40-23-11-6-3-1-2-4-8-18-32;;/h12-17,20-21H,1-11,18-19,22-23,25,32H2,(H,34,35);2*1H
Standard InChI Key: UTWHXOBIFJGEFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 42 0 0 0 0 0 0 0 0999 V2000
-0.6870 -2.2426 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.0717 -2.2426 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.9056 -0.6696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0318 0.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3168 -1.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0318 -0.6732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3426 -2.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6206 -1.8973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7413 -1.4056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6206 -1.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7502 0.5615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3098 0.5615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9180 -1.9880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8796 0.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1872 -1.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4722 0.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1612 0.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4722 -0.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3391 -3.1320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8713 1.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4344 0.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4468 1.6950 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.1494 1.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8713 0.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9209 -9.1273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4344 1.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1494 0.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7124 0.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 0.1430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9209 -8.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0541 -3.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0009 0.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8764 0.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2059 -8.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0541 -4.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2790 0.1430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7760 -4.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2059 -7.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1614 0.1430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4394 0.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4875 -6.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4875 -6.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7725 -5.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 11 1 0
5 6 1 0
6 4 1 0
7 8 1 0
8 10 1 0
9 5 3 0
10 3 1 0
11 16 1 0
12 4 2 0
13 7 2 0
3 14 2 0
15 3 1 0
16 18 1 0
17 14 1 0
18 15 2 0
19 7 1 0
20 24 2 0
21 28 1 0
22 20 1 0
23 26 2 0
24 27 1 0
25 30 1 0
26 21 1 0
27 21 2 0
28 32 1 0
29 12 1 0
30 34 1 0
31 19 1 0
32 36 1 0
33 29 1 0
34 38 1 0
35 31 1 0
36 40 1 0
37 35 1 0
38 41 1 0
39 33 1 0
40 39 1 0
41 42 1 0
42 43 1 0
43 37 1 0
17 16 2 0
23 20 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 588.17Molecular Weight (Monoisotopic): 587.3107AlogP: 5.91#Rotatable Bonds: 20Polar Surface Area: 134.87Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.21CX LogP: 2.47CX LogD: -0.14Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.03Np Likeness Score: -0.39
References 1. Binderup E, Björkling F, Hjarnaa PV, Latini S, Baltzer B, Carlsen M, Binderup L.. (2005) EB1627: a soluble prodrug of the potent anticancer cyanoguanidine CHS828., 15 (10): [PMID:15863303 ] [10.1016/j.bmcl.2005.03.064 ]