The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-Benzyl-1,2,4-triazolo[4,3-a]quinoxalin-1-yl)benzoic acid ID: ALA3621367
PubChem CID: 122191112
Max Phase: Preclinical
Molecular Formula: C23H16N4O2
Molecular Weight: 380.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccccc1-c1nnc2c(Cc3ccccc3)nc3ccccc3n12
Standard InChI: InChI=1S/C23H16N4O2/c28-23(29)17-11-5-4-10-16(17)21-25-26-22-19(14-15-8-2-1-3-9-15)24-18-12-6-7-13-20(18)27(21)22/h1-13H,14H2,(H,28,29)
Standard InChI Key: PILGWTRFIPDUIM-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
0.6426 0.8996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9460 0.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9460 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6426 -2.0562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6609 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9460 -2.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2678 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2678 0.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9460 0.8996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6609 0.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4601 2.5335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0843 1.1566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9547 2.3683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2280 -2.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1945 -3.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4749 -4.4202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4385 -5.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1216 -6.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8412 -5.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8776 -4.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0521 3.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3005 4.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7856 5.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2246 5.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5776 4.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4915 3.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7400 5.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6093 4.5317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0220 6.5253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 1 0
11 13 2 0
1 13 1 0
2 12 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
3 14 1 0
13 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 1 0
27 29 2 0
22 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.41Molecular Weight (Monoisotopic): 380.1273AlogP: 4.23#Rotatable Bonds: 4Polar Surface Area: 80.38Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.18CX Basic pKa: 1.15CX LogP: 3.63CX LogD: 0.18Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -0.89
References 1. Issa DAE, Habib NS, Abdel Wahab AE. (2015) Design, synthesis and biological evaluation of novel 1,2,4-triazolo and 1,2,4-triazino[4,3-a]quinoxalines as potential anticancer and antimicrobial agents, 6 (1): [10.1039/C4MD00257A ]