The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R,Z)-2-oleamidopropyl dihydrogen phosphate ID: ALA3621958
PubChem CID: 10432221
Max Phase: Preclinical
Molecular Formula: C21H42NO5P
Molecular Weight: 419.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](C)COP(=O)(O)O
Standard InChI: InChI=1S/C21H42NO5P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)22-20(2)19-27-28(24,25)26/h10-11,20H,3-9,12-19H2,1-2H3,(H,22,23)(H2,24,25,26)/b11-10-/t20-/m1/s1
Standard InChI Key: ZKHUPQDOUPORJL-JPMGXVIASA-N
Molfile:
RDKit 2D
28 27 0 0 0 0 0 0 0 0999 V2000
9.0999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 -1.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 -1.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 0.7500 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2606 0.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2609 1.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5013 2.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8013 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8027 4.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1027 5.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1041 6.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4041 7.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4055 9.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4450 9.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
5 7 1 6
6 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
9 12 1 0
1 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.54Molecular Weight (Monoisotopic): 419.2801AlogP: 5.64#Rotatable Bonds: 19Polar Surface Area: 95.86Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.61CX Basic pKa: ┄CX LogP: 5.80CX LogD: 2.60Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.14Np Likeness Score: 0.48
References 1. Gonzalez-Gil I, Zian D, Vazquez-Villa H, Ortega-Gutierrez S, Lopez-Rodriguez ML. (2015) The status of the lysophosphatidic acid receptor type 1 (LPA1R), 6 (1): [10.1039/C4MD00333K ]