(R,Z)-O-2-methoxy-3-(octadec-9-enyloxy)propyl O,O-dihydrogen phosphorothioate

ID: ALA3621961

PubChem CID: 122191543

Max Phase: Preclinical

Molecular Formula: C22H45O5PS

Molecular Weight: 452.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCCOC[C@H](COP(O)(O)=S)OC

Standard InChI:  InChI=1S/C22H45O5PS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-20-22(25-2)21-27-28(23,24)29/h10-11,22H,3-9,12-21H2,1-2H3,(H2,23,24,29)/b11-10-/t22-/m1/s1

Standard InChI Key:  FEHMGBUAJYEJMW-GMAFFVFYSA-N

Molfile:  

     RDKit          2D

 29 28  0  0  0  0  0  0  0  0999 V2000
   20.7998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3985   -1.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0985   -2.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0971   -3.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7971   -4.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7957   -6.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4957   -6.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4942   -8.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4548   -8.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3998    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0029   -1.5008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5998    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8998    0.7500    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   30.9389    1.3502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8998    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9392    0.1503    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.0430   -2.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
  1 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  6
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  2  0
 22 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3621961

    ---

Associated Targets(Human)

LPAR3 Tchem Lysophosphatidic acid receptor Edg-7 (471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
LPAR1 Tchem Lysophosphatidic acid receptor Edg-2 (779 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.64Molecular Weight (Monoisotopic): 452.2725AlogP: 6.28#Rotatable Bonds: 22
Polar Surface Area: 68.15Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.15CX Basic pKa: CX LogP: 7.40CX LogD: 4.17
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.11Np Likeness Score: 0.97

References

1. Gonzalez-Gil I, Zian D, Vazquez-Villa H, Ortega-Gutierrez S, Lopez-Rodriguez ML.  (2015)  The status of the lysophosphatidic acid receptor type 1 (LPA1R),  (1): [10.1039/C4MD00333K]

Source