The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,Z)-O-2-methoxy-3-(octadec-9-enyloxy)propyl O,O-dihydrogen phosphorothioate ID: ALA3621962
PubChem CID: 56947064
Product Number: A607509, Order Now?
Max Phase: Preclinical
Molecular Formula: C22H45O5PS
Molecular Weight: 452.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCCOC[C@@H](COP(O)(O)=S)OC
Standard InChI: InChI=1S/C22H45O5PS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-20-22(25-2)21-27-28(23,24)29/h10-11,22H,3-9,12-21H2,1-2H3,(H2,23,24,29)/b11-10-/t22-/m0/s1
Standard InChI Key: FEHMGBUAJYEJMW-YRBAHSOBSA-N
Molfile:
RDKit 2D
29 28 0 0 0 0 0 0 0 0999 V2000
20.7998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3985 -1.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0985 -2.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0971 -3.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7971 -4.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7957 -6.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4957 -6.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4942 -8.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4548 -8.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3998 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0029 -1.5008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5998 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8998 0.7500 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
30.9389 1.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8998 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9392 0.1503 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.0430 -2.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 1
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
25 28 2 0
22 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.64Molecular Weight (Monoisotopic): 452.2725AlogP: 6.28#Rotatable Bonds: 22Polar Surface Area: 68.15Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.15CX Basic pKa: ┄CX LogP: 7.40CX LogD: 4.17Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.11Np Likeness Score: 0.97
References 1. Gonzalez-Gil I, Zian D, Vazquez-Villa H, Ortega-Gutierrez S, Lopez-Rodriguez ML. (2015) The status of the lysophosphatidic acid receptor type 1 (LPA1R), 6 (1): [10.1039/C4MD00333K ]