The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(butane-1,4-diyl)bis(5,6-dihydroxy-1H-indole-2-carboxamide) ID: ALA3622460
PubChem CID: 16072597
Max Phase: Preclinical
Molecular Formula: C22H22N4O6
Molecular Weight: 438.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCCNC(=O)c1cc2cc(O)c(O)cc2[nH]1)c1cc2cc(O)c(O)cc2[nH]1
Standard InChI: InChI=1S/C22H22N4O6/c27-17-7-11-5-15(25-13(11)9-19(17)29)21(31)23-3-1-2-4-24-22(32)16-6-12-8-18(28)20(30)10-14(12)26-16/h5-10,25-30H,1-4H2,(H,23,31)(H,24,32)
Standard InChI Key: TYRJRBAMVHMUTQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2896 4.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7903 4.0267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5239 5.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0246 5.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9103 6.3672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8537 6.5608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9045 4.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3167 4.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2851 6.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5631 6.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8917 6.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9233 4.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6270 3.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9762 4.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9194 6.8097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
1 10 1 0
2 11 1 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 26 1 0
25 24 1 0
24 21 2 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
29 31 1 0
28 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.44Molecular Weight (Monoisotopic): 438.1539AlogP: 2.41#Rotatable Bonds: 7Polar Surface Area: 170.70Molecular Species: NEUTRALHBA: 6HBD: 8#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.39CX Basic pKa: ┄CX LogP: 1.32CX LogD: 1.28Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.16Np Likeness Score: -0.22
References 1. Pala N, Stevaert A, Dallocchio R, Dessì A, Rogolino D, Carcelli M, Sanna V, Sechi M, Naesens L.. (2015) Virtual Screening and Biological Validation of Novel Influenza Virus PA Endonuclease Inhibitors., 6 (8): [PMID:26288686 ] [10.1021/acsmedchemlett.5b00109 ]