The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8alpha-H-2beta-Ethyl-2alpha-methoxymethyl-salvinorin ether ID: ALA3622710
PubChem CID: 122191989
Max Phase: Preclinical
Molecular Formula: C25H34O7
Molecular Weight: 446.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@]1(COC)C[C@@H](C(=O)OC)[C@]2(C)CC[C@@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)[C@H]2C1=O
Standard InChI: InChI=1S/C25H34O7/c1-6-25(14-29-4)11-17(21(27)30-5)23(2)9-7-16-22(28)32-18(15-8-10-31-13-15)12-24(16,3)19(23)20(25)26/h8,10,13,16-19H,6-7,9,11-12,14H2,1-5H3/t16-,17+,18+,19+,23+,24+,25-/m1/s1
Standard InChI Key: PSXFNRVJRFXGLI-RXSHMUQTSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-3.4277 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4277 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1332 -2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1332 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8205 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8205 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 -2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0631 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0631 2.1879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 2.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 2.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7457 4.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9502 5.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4721 6.7481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9721 6.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5232 5.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1389 -3.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8426 -4.5544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1807 -4.3938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1361 1.6928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0907 0.0732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3694 1.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0581 2.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8473 -5.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8278 -2.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4036 1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6067 -0.5164 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6835 -0.5051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7058 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0385 3.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7357 -0.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
13 15 1 1
20 21 1 0
20 22 2 0
3 20 1 6
4 23 2 0
11 24 2 0
1 25 1 0
25 26 1 0
21 27 1 0
6 28 1 6
9 29 1 6
10 30 1 6
5 31 1 1
1 32 1 1
26 33 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.54Molecular Weight (Monoisotopic): 446.2305AlogP: 4.11#Rotatable Bonds: 5Polar Surface Area: 92.04Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.72CX LogD: 3.72Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: 2.13
References 1. Lee DY, Deng G, Ma Z, Xu W, Yang L, Liu J, Dai R, Liu-Chen LY.. (2015) Synthesis and biological evaluation of 2-alkyl-2-methoxymethyl-salvinorin ethers as selective κ-opioid receptor agonists., 25 (20): [PMID:26330078 ] [10.1016/j.bmcl.2015.06.092 ]