8beta-H-2beta-Allyl-2alpha-methoxymethyl-salvinorin ether

ID: ALA3622714

PubChem CID: 122191993

Max Phase: Preclinical

Molecular Formula: C26H34O7

Molecular Weight: 458.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC[C@]1(COC)C[C@@H](C(=O)OC)[C@]2(C)CC[C@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)[C@H]2C1=O

Standard InChI:  InChI=1S/C26H34O7/c1-6-9-26(15-30-4)12-18(22(28)31-5)24(2)10-7-17-23(29)33-19(16-8-11-32-14-16)13-25(17,3)20(24)21(26)27/h6,8,11,14,17-20H,1,7,9-10,12-13,15H2,2-5H3/t17-,18-,19-,20-,24-,25-,26+/m0/s1

Standard InChI Key:  XKFMTFBISBVELP-MYGUGTDKSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -3.4277    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4277   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1332   -2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1332    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8205    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8205   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558   -2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0631    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0631    2.1879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503    2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558    2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7457    4.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9502    5.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4721    6.7481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9721    6.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5232    5.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1389   -3.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8426   -4.5544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1807   -4.3938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1361    1.6928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0907    0.0732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3694    1.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8473   -5.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8278   -2.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4036    1.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6067   -0.5164    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6835   -0.5051    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7058   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0581    2.2104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0385    3.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9939    0.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0426   -0.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 13 15  1  1
 20 21  1  0
 20 22  2  0
  3 20  1  6
  4 23  2  0
 11 24  2  0
  1 25  1  0
 21 26  1  0
  6 27  1  6
  9 28  1  6
 10 29  1  1
  5 30  1  1
  1 31  1  1
 25 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3622714

    ---

Associated Targets(Human)

OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Oprd1 Delta opioid receptor (3127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprm1 Mu opioid receptor (6060 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.55Molecular Weight (Monoisotopic): 458.2305AlogP: 4.28#Rotatable Bonds: 6
Polar Surface Area: 92.04Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.87CX LogD: 3.87
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: 2.22

References

1. Lee DY, Deng G, Ma Z, Xu W, Yang L, Liu J, Dai R, Liu-Chen LY..  (2015)  Synthesis and biological evaluation of 2-alkyl-2-methoxymethyl-salvinorin ethers as selective κ-opioid receptor agonists.,  25  (20): [PMID:26330078] [10.1016/j.bmcl.2015.06.092]

Source